HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Chloro-6-nitroquinazoline
4-Chloro-6-nitro-quizoline · 4-choro-6-nitroquinazoline · 4-CHLORO-6-NITROQUINAZOLINE · Quinazoline,4-chloro-6-nitro-
Identifikatoren & physikalische Daten
| CAS No. | 19815-16-8 |
|---|---|
| Summenformel | C8H4ClN3O2 |
| Durchschnittliche Molmasse | 209,59 g/mol |
| Monoisotopische Masse | 208,99920405 g/mol |
| SMILES | O=[N+]([O-])c1ccc2ncnc(Cl)c2c1 |
| InChIKey | LZOSFEDULGODDH-UHFFFAOYSA-N |
| PubChem CID | 11356257 |
| EC No. | 972-052-0 |
| DTXSID | DTXSID10463364 |
Chemische & physikalische Eigenschaften
| XLogP | 2,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 71,6 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 14 |
| Formalladung | 0 |
| Komplexität | 233 |
| Schmelzpunkt | 128 °C |
| Siedepunkt | 380.0±22.0 °C(Predicted) |
| Dichte | 1.566±0.06 g/cm3(Predicted) |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2-8°C |
| Löslichkeit | Dichloromethane |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 0.14±0.50(Predicted) |
| Farbe | Brown |
| CAS Datenbank | 19815-16-8 |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Alarmwort | Warnung |
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Intermediate in the preparation of anticancer agents and enzyme inhibitors.