9-Anthraceneboronic Acid
Anthracen-9-ylboronic acid · 9-Anthracenylboronic acid · ANTHRACENE-9-BORONIC ACID · DKI84 · CAS:100622-34-2 · 9-Boronoanthracene · 9-Anthracenylboronic · 9-Anthrylboronicacid
Identifikatoren & physikalische Daten
| CAS No. | 100622-34-2 |
|---|---|
| Summenformel | C14H11BO2 |
| Durchschnittliche Molmasse | 222,05 g/mol |
| Monoisotopische Masse | 222,08520999 g/mol |
| SMILES | OB(O)c1c2ccccc2cc2ccccc12 |
| InChIKey | VHHDLIWHHXBLBK-UHFFFAOYSA-N |
| PubChem CID | 15510213 |
| EC No. | 626-419-4 |
| DTXSID | DTXSID80573500 |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 40,5 |
|---|---|
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 17 |
| Formalladung | 0 |
| Komplexität | 247 |
| Schmelzpunkt | 203-250 °C |
| Siedepunkt | 479.5±28.0 °C(Predicted) |
| Dichte | 1.26±0.1 g/cm3(Predicted) |
| Lagerbedingungen | Keep in dark place,Sealed in dry,Room Temperature |
| Löslichkeit | soluble in Methanol |
| pKa (Säurekonstante) | 8.53±0.30(Predicted) |
| Aggregatzustand | Crystalline Solid |
| Farbe | White to tan |
| BRN | 3301031 |
| InChI | InChI=1S/C14H11BO2/c16-15(17)14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9,16-17H |
| InChIKey | VHHDLIWHHXBLBK-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2)C=CC=C3)=CC=C1B(O)O |
| CAS Datenbank | 100622-34-2(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH301 (93.2%): Toxic if swallowed [Danger Acute toxicity, oral]P264, P270, P301+P316, P321, P330, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 3 (93.2%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | No |
| UN-Transportnummer | UN 2811 6.1/PG 3 |
| Zollcode | 29319090 |
| R-Sätze (R) | 36/37/38-25 |
| Gefahrensymbole | T |
| Sicherheitshinweise (S) | 26-36-45 |
| Gefahrenklasse | 6.1Acute Tox. 3 Oral |
| Verpackungsgruppe | Ⅲ |
| Lagerklasse | 6.1D - Non-combustible acute toxic Cat.3toxic hazardous materials or hazardous materials causing chronic effects |
Anwendungen & Verwendung
Beschreibung
9-Anthraceneboronic acid is a boronic acid compound mainly used as an organic synthesis and reaction reagent. The addition of 9-Anthraceneboronic acid introduces a borate ester bond and an anthracene functional group into ordinary polyvinyl alcohol, which can be used to prepare the composite material poly(vinyl alcohol) anthraceneboronic acid (PVA-ABA), which is suitable for sustainable engineering applications due to its high mechanical strength and toughness, good water resistance, chemical durability, and ease of recycling. It can also be used to prepare stimuli-responsive polymeric materials and highly efficient luminescent materials.
Verwenden
suzuki reaction