Identifikatoren & physikalische Daten
| CAS No. | 767567-84-0 |
|---|
| Summenformel | C7H8N2O2 |
|---|
| Durchschnittliche Molmasse | 152,15 g/mol |
|---|
| SMILES | Cc1ccc([N+](=O)[O-])c(C)n1 |
|---|
| InChIKey | AETHUDGJSSKZKT-UHFFFAOYSA-N |
|---|
| EC No. | 239-543-5 |
|---|
Chemische & physikalische Eigenschaften
| XLogP | 1,5 |
|---|
| Polarare Oberfläche (TPSA) | 58,7 |
|---|
| H-Brücken-Donoren | 0 |
|---|
| H-Brücken-Akzeptoren | 3 |
|---|
| Frei drehbare Bindungen | 0 |
|---|
| Schwere Atome | 11 |
|---|
| Formalladung | 0 |
|---|
| Komplexität | 155 |
|---|
| SpringerMaterials Properties | Nuclear quadrupole resonance spectroscopy |
|---|
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH228 (100%): Flammable solid [Danger Flammable solids]P210, P240, P241, P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 40 reports by companies from 3 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Flam. Sol. 2 (100%) |
|---|
