HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Methandriol
Hibol · Masdiol · Megabion · Nabadial · Neostene · Stenibel · Androdiol · Cenabolic
Identifikatoren & physikalische Daten
| CAS No. | 521-10-8 |
|---|---|
| Summenformel | C20H32O2 |
| Durchschnittliche Molmasse | 304,5 g/mol |
| Monoisotopische Masse | 304,24023026 g/mol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@]2(C)O |
| InChIKey | WRWBCPJQPDHXTJ-DTMQFJJTSA-N |
| PubChem CID | 229021 |
| ChEMBL | CHEMBL1079446 |
| ChEBI | CHEBI:34834 |
| EC No. | 208-301-0 |
| DTXSID | DTXSID50878534 |
| Lokaler Name | Methandriol |
Chemische & physikalische Eigenschaften
| XLogP | 3,7 |
|---|---|
| Polarare Oberfläche (TPSA) | 40,5 |
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 22 |
| Formalladung | 0 |
| Komplexität | 512 |
| Arzneimittel | DEA Schedule III Controlled Substance -> Anabolic steroidsPharmaceuticals -> Synthetic Cannabinoids or Psychoactive Compounds |
| Lipide | Lipids -> Sterol Lipids [ST] -> Steroids [ST02] -> C19 steroids (androgens) and derivatives [ST0202] |
| SpringerMaterials Properties | Chemical shift |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Schmelzpunkt | 205 °C |
| Siedepunkt | 385.28°C (rough estimate) |
| Dichte | 1.0279 (rough estimate) |
| Brechungsindex | -75 ° (C=1, EtOH) |
| Löslichkeit | Acetonitrile: 1 mg/mlEthanol: 1 mg/mlMethanol: 1 mg/ml |
| Aggregatzustand | A crystalline solid |
| pKa (Säurekonstante) | 15.01±0.70(Predicted) |
| Farbe | Crystals from ethyl acetate |
| Merck | 5950 |
| CAS Datenbank | 521-10-8(CAS DataBase Reference) |
| NIST chemische Informationen | Methandriol(521-10-8) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P264, P270, P280, P301+P317, P302+P352, P317, P318, P321, P330, P362+P364, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 38 reports by companies from 1 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatorische Informationen | DEA schedule III controlled substance |
| Weitere Sicherheitsinformationen | IMAP assessments - Androst-5-ene-3,17-diol, 17-methyl-, (3.beta.,17.beta.)-: Environment tier I assessment |
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| UN-Transportnummer | 3249 |
| Zollcode | 29061990 |
| RTECS-Nr. | BV8100000 |
| R-Sätze (R) | 20/21/22-40 |
| Gefahrensymbole | Xn |
| Sicherheitshinweise (S) | 16-23-36 |
| Gefahrenklasse | 6.1(b) |
| Verpackungsgruppe | III |
| DEA Controlled Substances | CSCN: 4000CSA SCH: Schedule IIINARC: No |
Anwendungen & Verwendung
Verwenden
A metabolite of 17α-Methyltestosterone (M326400).