HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
5-Formylfuran-2-boronic acid
5-FORMYL-2-FURYLBORONIC ACID · 5-Formylfuran-2-ylboronic acid · (5-FORMYL-2-FURANYL)BORONIC ACID · FFBA · AKOS BRN-0038 · CHEMBRDG-BB 3200975 · TIMTEC-BB SBB004171 · RARECHEM AH PB 0213
Identifikatoren & physikalische Daten
| CAS No. | 27329-70-0 |
|---|---|
| Summenformel | C5H5BO4 |
| Durchschnittliche Molmasse | 139,9 g/mol |
| Monoisotopische Masse | 140,02808904 g/mol |
| SMILES | O=Cc1ccc(B(O)O)o1 |
| InChIKey | JUWYQISLQJRRNT-UHFFFAOYSA-N |
| PubChem CID | 2734355 |
| EC No. | 628-001-7 |
| DTXSID | DTXSID50370245 |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 70,7 |
|---|---|
| H-Brücken-Donoren | 2 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 127 |
| Schmelzpunkt | 136 °C (dec.) (lit.) |
| Siedepunkt | 379.3±52.0 °C(Predicted) |
| Dichte | 1.36±0.1 g/cm3(Predicted) |
| Lagerbedingungen | Inert atmosphere,Store in freezer, under -20°C |
| Löslichkeit | 1.38g/lInsoluble in water. |
| pKa (Säurekonstante) | 7.11±0.53(Predicted) |
| Aggregatzustand | powder |
| Farbe | brown |
| BRN | 1637050 |
| InChI | InChI=1S/C5H5BO4/c7-3-4-1-2-5(10-4)6(8)9/h1-3,8-9H |
| InChIKey | JUWYQISLQJRRNT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=O)O1)(O)O |
| CAS Datenbank | 27329-70-0(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH314 (87.2%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P319, P321, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 47 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Corr. 1B (87.2%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | No |
| UN-Transportnummer | UN 3261 8/PG 3 |
| Zollcode | 29321900 |
| R-Sätze (R) | 34-36/37/38 |
| Gefahrensymbole | C,Xi |
| hazard_note | Irritant |
| Sicherheitshinweise (S) | 26-36/37/39-45-37/39-27 |
| Gefahrenklasse | IRRITANT, KEEP COLDSkin Corr. 1B |
| Verpackungsgruppe | Ⅲ |
| Lagerklasse | 8A - Combustible corrosive hazardous materials |
Anwendungen & Verwendung
Verwenden
suzuki reaction