HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
2-Chloro-4-fluoropyridine
2-Chlro-4-fluorpyridine · 2-Cloro-4-fluoropyridine · 2-CHLORO-4-FULOROPYRIDINE · 2-CHLORO-4-FLUOROPYRIDINE · Pyridine, 2-chloro-4-fluoro- · 2-Chloro-4-fluoropyridine>2--4- fluoropyridinechloride · 2-Chloro-4-fluoropyridine,97% · 2-Chloro-4-fluoropyridine AldrichCPR
Identifikatoren & physikalische Daten
| CAS No. | 34941-91-8 |
|---|---|
| Summenformel | C5H3ClFN |
| Durchschnittliche Molmasse | 131,53 g/mol |
| Monoisotopische Masse | 130,993805 g/mol |
| SMILES | Fc1ccnc(Cl)c1 |
| InChIKey | FGSAQRJRWCZLOB-UHFFFAOYSA-N |
| PubChem CID | 2782792 |
| EC No. | 675-788-8 |
| DTXSID | DTXSID20382299 |
Chemische & physikalische Eigenschaften
| XLogP | 1,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 12,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 8 |
| Formalladung | 0 |
| Komplexität | 78,8 |
| Siedepunkt | 140°C |
| Dichte | 1,456g/cm |
| Flammpunkt | 140°C |
| Brechungsindex | 1.5015 |
| Lagerbedingungen | Inert atmosphere,2-8°C |
| pKa (Säurekonstante) | 1.20±0.10(Predicted) |
| Aggregatzustand | Liquid |
| Farbe | Colorless to pale yellow |
| BRN | 1634747 |
| InChI | InChI=1S/C5H3ClFN/c6-5-3-4(7)1-2-8-5/h1-3H |
| InChIKey | FGSAQRJRWCZLOB-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(F)=C1 |
| CAS Datenbank | 34941-91-8(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH226 (97.9%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 8 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (97.9%) |
| Wassergefährdungsklasse (WGK) | WGK 3 |
| UN-Transportnummer | 1993 |
| Zollcode | 29333990 |
| R-Sätze (R) | 20/21/22-36/37/38-10 |
| Gefahrensymbole | Xi,F,Xn |
| hazard_note | Flammable/Irritant |
| Sicherheitshinweise (S) | 26-36/37/39-36 |
| Gefahrenklasse | TOXIC, FLAMMABLEAcute Tox. 4 DermalAcute Tox. 4 InhalationAcute Tox. 4 OralEye Irrit. 2Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 3 - Flammable liquids |
Anwendungen & Verwendung
Verwenden
2-Chloro-4-fluoropyridine is a useful research chemical.