HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Undec-10-insure
undec-10-ynoic acid · 10-undecynoate · 10-cyanic acid · Hendecynoic acid · undec-10-ynoicaci · 10-Undecynoic acid · TIMTEC-BB SBB008483 · 10-Undecynoic acid 95%
Identifikatoren & physikalische Daten
| CAS No. | 2777-65-3 |
|---|---|
| Summenformel | C11H18O2 |
| Durchschnittliche Molmasse | 182,26 g/mol |
| Monoisotopische Masse | 182,13067982 g/mol |
| SMILES | C#CCCCCCCCCC(=O)O |
| InChIKey | OAOUTNMJEFWJPO-UHFFFAOYSA-N |
| PubChem CID | 31039 |
| ChEBI | CHEBI:185054 |
| EC No. | 220-471-8 |
| DTXSID | DTXSID2075219 |
| Lokaler Name | Undec-10-insure |
Chemische & physikalische Eigenschaften
| XLogP | 3,3 |
|---|---|
| Polarare Oberfläche (TPSA) | 37,3 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 8 |
| Schwere Atome | 13 |
| Formalladung | 0 |
| Komplexität | 176 |
| Lipide | Fatty Acyls [FA] -> Fatty Acids and Conjugates [FA01] -> Unsaturated fatty acids [FA0103] |
| Schmelzpunkt | 40-42 °C (lit.) |
| Siedepunkt | 180 °C/15 mmHg (lit.) |
| Dichte | 0.9898 (rough estimate) |
| Brechungsindex | 1.4066 (estimate) |
| Flammpunkt | >230 °F |
| Lagerbedingungen | Refrigerator |
| Löslichkeit | Chloroform (Slightly), Ethyl Acetate (Slightly)Sparingly Soluble in water. |
| Aggregatzustand | Solid |
| pKa (Säurekonstante) | 4.78±0.10(Predicted) |
| Farbe | Off-White |
| BRN | 1704918 |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| InChIKey | OAOUTNMJEFWJPO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCC#C |
| CAS Datenbank | 2777-65-3(CAS DataBase Reference) |
| EPA chemische Informationen | 10-Undecynoic acid (2777-65-3) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| F | 10-23 |
| Wassergefährdungsklasse (WGK) | 3 |
| Zollcode | 29161900 |
| RTECS-Nr. | YQ3683000 |
| R-Sätze (R) | 36/37/38 |
| Toxizität | mouse,LD50,intravenous,32mg/kg (32mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#07969, |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Anwendungen & Verwendung
Verwenden
10-Undecynoic Acid is a fatty acid used in the synthesis of copolyesters.