HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Chindoxin
GROFAS · ICI 8173 · quindoxin · QUINOXALINEDI-N-OXIDE · QUINOXALINE-1,4-DIOXIDE · Quinoxaline N,N'-Dioxide · quinoxaline 1,4-di-N-oxide · 4-oxidoquinoxalin-1-ium 1-oxide
Identifikatoren & physikalische Daten
| CAS No. | 2423-66-7 |
|---|---|
| Summenformel | C8H6N2O2 |
| Durchschnittliche Molmasse | 162,15 g/mol |
| Monoisotopische Masse | 162,04292743 g/mol |
| SMILES | O=[n+]1ccn([O-])c2ccccc21 |
| InChIKey | CKIHZSGJPSDCNC-UHFFFAOYSA-N |
| PubChem CID | 72073 |
| ChEMBL | CHEMBL2104626 |
| ChEBI | CHEBI:179448 |
| EC No. | 219-352-3 |
| DTXSID | DTXSID8046165 |
| Lokaler Name | Chindoxin |
Chemische & physikalische Eigenschaften
| XLogP | -0,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 46,4 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 12 |
| Formalladung | 0 |
| Komplexität | 206 |
| Arzneimittel | Pharmaceuticals -> Antibiotics |
| Schmelzpunkt | 241 - 243 °C242°C |
| Physical Description | Solid |
| Siedepunkt | 288.82°C (rough estimate) |
| Dichte | 1.3264 (rough estimate) |
| Brechungsindex | 1.5770 (estimate) |
| pKa (Säurekonstante) | 2.67±0.10(Predicted) |
Sicherheit & Vorschriften
| Alarmwort | Warnung |
|---|---|
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Quindoxin is a potential anti-bacterial agent with a wide range biological properties. Also, it potentially display anti-malarial, anti-leishmanial and anti-tuberculosis activity. Potent anti-mycobacterium tuberculosis agent.