HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Tetramethylammoniumnitrat
N1,1,1,1NO3 · etramethylazanium,nitrate · tetramethylazanium,nitrate · TetraMethylaMMoniuM nitrat · TETRAMETHYLAMMONIUM NITRATE · Tetramethylammonium nitrate,96% · AMMONIUM, TETRAMETHYL-, NITRATE · Tetramethylammonium Nitrate,99%
Identifikatoren & physikalische Daten
| CAS No. | 1941-24-8 |
|---|---|
| Summenformel | C4H12N2O3 |
| Durchschnittliche Molmasse | 136,15 g/mol |
| Monoisotopische Masse | 136,08479224 g/mol |
| SMILES | C[N+](C)(C)C.O=[N+]([O-])[O-] |
| InChIKey | QGPVYHSXZFOSRL-UHFFFAOYSA-N |
| PubChem CID | 74743 |
| EC No. | 217-723-4 |
| DTXSID | DTXSID8062074 |
| Lokaler Name | Tetramethylammoniumnitrat |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 62,9 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 3 |
| Frei drehbare Bindungen | 0 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 37,9 |
| Stoffklassen | Nitrogen Compounds -> Quaternary Amines |
| Physical Description | White odorless crystals[Alfa Aesar MSDS] |
| Schmelzpunkt | ≥300 °C(lit.) |
| Siedepunkt | 250.42°C (rough estimate) |
| Dichte | 1.2844 (rough estimate) |
| Brechungsindex | 1.4800 (estimate) |
| Lagerbedingungen | 2-8°C, sealed storage, away from moisture |
| Löslichkeit | H2O: 0.1 g/mL, clear, colorlessSoluble in water. |
| Aggregatzustand | Crystalline |
| BRN | 3917260 |
| Stabilität | Stable. Reacts with rust, bases, copper, strong oxidizing agents, reducing agents. |
| InChI | 1S/C4H12N.NO3/c1-5(2,3)42-1(3)4/h1-4H3/q+1 |
| InChIKey | QGPVYHSXZFOSRL-UHFFFAOYSA-N |
| SMILES | [O-][N+]([O-])=O.C[N+](C)(C)C |
| CAS Datenbank | 1941-24-8(CAS DataBase Reference) |
| EPA chemische Informationen | Methanaminium, N,N,N-trimethyl-, nitrate (1941-24-8) |
Sicherheit & Vorschriften
| GHS-Einstufung | DangerH272 (100%): May intensify fireoxidizer [Danger Oxidizing liquidsOxidizing solids]P210, P220, P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 172 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Gefahrenübersicht | An oxidizer that may cause fire on contact with combustible materialsA skin and strong eye irritant[Alfa Aesar MSDS] |
| Hazard Classes and Categories | Ox. Sol. 2 (100%) |
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 1479 5.1/PG 2 |
| Zollcode | 29239000 |
| R-Sätze (R) | 8-36/37/38 |
| Gefahrensymbole | O,Xi |
| Sicherheitshinweise (S) | 17-26-36 |
| Gefahrenklasse | 5.1Eye Irrit. 2Ox. Sol. 2Skin Irrit. 2STOT SE 3 |
| Verpackungsgruppe | III |
| Lagerklasse | 5.1B - Oxidizing hazardous materials |
Anwendungen & Verwendung
Verwenden
Tetramethylammonium Nitrate can be used as a glycolate oxidase inhibitors.