HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
3-Bromstyrol
1-Bromo-3-vinylbenzene · M-BROMOSTYRENE · m-Bromostyrol · 3-BROMOSTYRENE · 3-Bromostyrolene · B**3-BROMOSTYRENE · 3-Bromovinylbenzen · 3-BROMOSTYRENE 97%
Identifikatoren & physikalische Daten
| CAS No. | 2039-86-3 |
|---|---|
| Summenformel | C8H7Br |
| Durchschnittliche Molmasse | 183,04 g/mol |
| Monoisotopische Masse | 181,97311 g/mol |
| SMILES | C=Cc1cccc(Br)c1 |
| InChIKey | KQJQPCJDKBKSLV-UHFFFAOYSA-N |
| PubChem CID | 74870 |
| EC No. | 218-025-2 |
| DTXSID | DTXSID60174332 |
| Lokaler Name | 3-Bromstyrol |
Chemische & physikalische Eigenschaften
| XLogP | 3,4 |
|---|---|
| Polarare Oberfläche (TPSA) | 0 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 0 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 9 |
| Formalladung | 0 |
| Komplexität | 98 |
| Siedepunkt | 74-75 °C/3 mmHg (lit.) |
| Dichte | 1.406 g/mL at 25 °C (lit.) |
| Brechungsindex | n20/D 1.591(lit.) |
| Flammpunkt | 154 °F |
| Lagerbedingungen | 2-8°C |
| Aggregatzustand | Liquid |
| Wichte | 1.406 |
| Farbe | Clear colorless to yellow |
| BRN | 2038490 |
| InChI | InChI=1S/C8H7Br/c1-2-7-4-3-5-8(9)6-7/h2-6H,1H2 |
| InChIKey | KQJQPCJDKBKSLV-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(C=C)=C1 |
| CAS Datenbank | 2039-86-3(CAS DataBase Reference) |
| NIST chemische Informationen | 3-BrC6H4CH=CH2(2039-86-3) |
Sicherheit & Vorschriften
| Wassergefährdungsklasse (WGK) | 3 |
|---|---|
| UN-Transportnummer | 1993 |
| Zollcode | 29039990 |
| R-Sätze (R) | 36/37/38 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 26-36/37/39 |
| Gefahrenklasse | IRRITANTEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Lagerklasse | 10 - Combustible liquids |
Anwendungen & Verwendung
Verwenden
1-Bromo-3-vinylbenzene acts as a reagent in the synthesis of methylaminopropiophenones used as a muscle relaxant in rats.