HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Benzophenon-3,3':4,4'-tetracarbonsaeuredianhydrid
BTDA · NOTAVAILABLE · 5,5'-Carbonylbis(isobenzofuran-1,3-dione) · 4,4'-CARBONYLDIPHTHALIC ANHYDRIDE · Benzophenone-3,3',4,4'-tetracarboxylic dianhydride · 3,3',4,4'-Benzophenonetetracarboxylic acid dianhydride · 5,5'-Carbonylbis · LABOTEST-BB LT02097910
Identifikatoren & physikalische Daten
| CAS No. | 2421-28-5 |
|---|---|
| Summenformel | C17H6O7 |
| Durchschnittliche Molmasse | 322,22 g/mol |
| Monoisotopische Masse | 322,01135253 g/mol |
| SMILES | O=C(c1ccc2c(c1)C(=O)OC2=O)c1ccc2c(c1)C(=O)OC2=O |
| InChIKey | VQVIHDPBMFABCQ-UHFFFAOYSA-N |
| PubChem CID | 75498 |
| ChEMBL | CHEMBL3183537 |
| EC No. | 219-348-1 |
| DTXSID | DTXSID3029233 |
| Lokaler Name | Benzophenon-3,3':4,4'-tetracarbonsaeuredianhydrid |
Chemische & physikalische Eigenschaften
| XLogP | 2 |
|---|---|
| Polarare Oberfläche (TPSA) | 104 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 7 |
| Frei drehbare Bindungen | 2 |
| Schwere Atome | 24 |
| Formalladung | 0 |
| Komplexität | 597 |
| Schmelzpunkt | 218-222 °C (lit.) |
| Siedepunkt | 320°C 5mm |
| Dichte | 1,57 g/cm3 |
| Dampfdichte | 1.4 (vs air) |
| Dampfdruck | <0.1 mm Hg ( 0 °C) |
| Brechungsindex | 1.6380 (estimate) |
| Flammpunkt | 324 °C |
| Lagerbedingungen | Inert atmosphere,Room Temperature |
| Löslichkeit | DMF: 0.1 g/mL, clearREACTS |
| Aggregatzustand | Needles or Crystalline Powder |
| Farbe | Off-white to brown |
| Explosionsgrenze | 16% |
| BRN | 761777 |
| Stabilität | Hygroscopic |
| InChI | 1S/C17H6O7/c18-13(7-1-3-9-11(5-7)16(21)23-14(9)19)8-2-4-10-12(6-8)17(22)24-15(10)20/h1-6H |
| InChIKey | VQVIHDPBMFABCQ-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)c2cc(ccc12)C(=O)c3ccc4C(=O)OC(=O)c4c3 |
| LogP (Verteilungskoeffizient) | 3.3 at 25℃ |
| NIST chemische Informationen | Bis-(3-phthalyl anhydride) ketone(2421-28-5) |
| EPA chemische Informationen | Benzophenonetetracarboxylic dianhydride (2421-28-5) |
Sicherheit & Vorschriften
| F | 21 |
|---|---|
| Wassergefährdungsklasse (WGK) | 1 |
| TSCA-Inventar-Status | TSCA listed |
| Zollcode | 29183000 |
| R-Sätze (R) | 36/37 |
| Gefahrensymbole | Xi |
| Sicherheitshinweise (S) | 25 |
| Lagerklasse | 11 - Combustible Solids |
| Gefahrenklasse | Eye Irrit. 2STOT SE 3 |
| Selbstentzündungstemperatur | 975 °F |
Anwendungen & Verwendung
Verwenden
BTDA is important monomer of polyimide, and used for production of polyimide material.