HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-(Aminomethyl)benzonitril
4-(AMINOMETHYL)BENZONITRILE · AKOS BB-9165 · 4-CNBAM X HCL · CyanobenzylaMine · 4-Cyanobenzyamine · 4-CYANOBENZYLAMINE · p-Cyanobenzylamine · α-AMino-p-tolunitrile
Identifikatoren & physikalische Daten
| CAS No. | 10406-25-4 |
|---|---|
| Summenformel | C8H8N2 |
| Durchschnittliche Molmasse | 132,16 g/mol |
| Monoisotopische Masse | 132,06874826 g/mol |
| SMILES | N#Cc1ccc(CN)cc1 |
| InChIKey | LFIWXXXFJFOECP-UHFFFAOYSA-N |
| PubChem CID | 82608 |
| ChEMBL | CHEMBL4068773 |
| EC No. | 233-877-5 |
| DTXSID | DTXSID40146234 |
| Lokaler Name | 4-(Aminomethyl)benzonitril |
Chemische & physikalische Eigenschaften
| XLogP | 0,9 |
|---|---|
| Polarare Oberfläche (TPSA) | 49,8 |
| H-Brücken-Donoren | 1 |
| H-Brücken-Akzeptoren | 2 |
| Frei drehbare Bindungen | 1 |
| Schwere Atome | 10 |
| Formalladung | 0 |
| Komplexität | 137 |
| Schmelzpunkt | 274-279 °C(lit.) |
| Siedepunkt | 92 °C(Press: 5 Torr) |
| Dichte | 1.1 |
| Lagerbedingungen | under inert gas (nitrogen or Argon) at 2–8 °C |
| Aggregatzustand | liquid |
| pKa (Säurekonstante) | 8.47±0.10(Predicted) |
| Farbe | Dark yellow |
| InChI | InChI=1S/C8H8N2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5,9H2 |
| InChIKey | LFIWXXXFJFOECP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(CN)C=C1 |
| CAS Datenbank | 10406-25-4(CAS DataBase Reference) |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (93%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 43 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (93%) |
| Wassergefährdungsklasse (WGK) | 3 |
| UN-Transportnummer | UN2735 |
| Zollcode | 2926907090 |
| R-Sätze (R) | 22 |
| Gefahrensymbole | T,Xn |
| Sicherheitshinweise (S) | 22-24/25 |
| Gefahrenklasse | TOXICAcute Tox. 4 Oral |
| Lagerklasse | 11 - Combustible Solids |
Anwendungen & Verwendung
Verwenden
Intermediate in the preparation of Ximelagatran.