HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
4-Methoxy-N,N-bis(4-methoxyphenyl)benzenamine
Tris(4-methoxyphenyl)amine · 4-methoxy-N,N-bis(4-methoxyphenyl)aniline · 4-Methoxy-N,N-bis(4-methoxyphenyl)benzenamine · Benzenamine, 4-methoxy-N,N-bis(4-methoxyphenyl)- · 4-methoxy-N,N-bis(4-methoxyphenyl)benzenemethylamine
Identifikatoren & physikalische Daten
| CAS No. | 13050-56-1 |
|---|---|
| Summenformel | C21H21NO3 |
| Durchschnittliche Molmasse | 335,4 g/mol |
| Monoisotopische Masse | 335,15214353 g/mol |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChIKey | AMLOAIZZHUTCIJ-UHFFFAOYSA-N |
| PubChem CID | 9862546 |
| EC No. | 170-418-7 |
| DTXSID | DTXSID80432047 |
Chemische & physikalische Eigenschaften
| XLogP | 5,1 |
|---|---|
| Polarare Oberfläche (TPSA) | 30,9 |
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 4 |
| Frei drehbare Bindungen | 6 |
| Schwere Atome | 25 |
| Formalladung | 0 |
| Komplexität | 310 |
| Lagerbedingungen | 2-8°C, protect from light |
| InChI | InChI=1S/C21H21NO3/c1-23-19-10-4-16(5-11-19)22(17-6-12-20(24-2)13-7-17)18-8-14-21(25-3)15-9-18/h4-15H,1-3H3 |
| InChIKey | AMLOAIZZHUTCIJ-UHFFFAOYSA-N |
| SMILES | C1(N(C2=CC=C(OC)C=C2)C2=CC=C(OC)C=C2)=CC=C(OC)C=C1 |
Sicherheit & Vorschriften
| GHS-Einstufung | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| Alarmwort | Warnung |
| Gefahrenhinweise | Code Gefahrenhinweise Gefahrenklasse Abteilung Alarmwort Symbol P-Code H302 |
Anwendungen & Verwendung
Verwenden
Tris(4-methoxyphenyl)amine acts as a mediator in dye-sensitized solar cells.