HuagongsheHuagongshe Chemie-Druckbericht · Nur für Forschungszwecke
Tetrabutylammoniumtetrahydroborat
Cyanoborohydride · ammonium borohydride · boranuide · [Reducing Reagent] · N,N,N-Tributyl-1-B · Tetrabutylammoniumboranate · tetrabutylazanium boranuide · TetrabutylammoniumBorohydrate
Identifikatoren & physikalische Daten
| CAS No. | 33725-74-5 |
|---|---|
| Summenformel | C16H36BN |
| Durchschnittliche Molmasse | 253,3 g/mol |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[B-] |
| InChIKey | SGIQRFZMJGZMNT-UHFFFAOYSA-N |
| PubChem CID | 9881569 |
| Lokaler Name | Tetrabutylammoniumtetrahydroborat |
Chemische & physikalische Eigenschaften
| Polarare Oberfläche (TPSA) | 0 |
|---|---|
| H-Brücken-Donoren | 0 |
| H-Brücken-Akzeptoren | 1 |
| Frei drehbare Bindungen | 12 |
| Schwere Atome | 18 |
| Formalladung | 0 |
| Komplexität | 116 |
| Schmelzpunkt | 124-128 °C (lit.) |
| Flammpunkt | 140°(284°F) |
| Lagerbedingungen | Store below +30°C. |
| Löslichkeit | Chloroform (Sparingly), DMSO (Sparingly, Heated, Sonicated), Methanol (SlightlySoluble |
| Aggregatzustand | Crystalline Powder and Chunks |
| Farbe | White |
| BRN | 4212332 |
| Stabilität | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C16H36N.BH4/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h5-16H2,1-4H31H4/q+1 |
| InChIKey | GMBOFJFPOCGSOI-UHFFFAOYSA-N |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.[B+3]([H-])([H-])([H-])[H-] |
| CAS Datenbank | 33725-74-5(CAS DataBase Reference) |
| EPA chemische Informationen | 1-Butanaminium, N,N,N-tributyl-, tetrahydroborate(1-) (33725-74-5) |
Sicherheit & Vorschriften
| F | 10 |
|---|---|
| Wassergefährdungsklasse (WGK) | 3 |
| TSCA-Inventar-Status | TSCA listed |
| UN-Transportnummer | UN 3131 4.3/PG 2 |
| Zollcode | 29239000 |
| R-Sätze (R) | 15-34-36/37/38 |
| Gefahrensymbole | F,C,Xi |
| hazard_note | Flammable/Corrosive/Moisture Sensitive |
| Sicherheitshinweise (S) | 26-36/37/39-43-7/8-37/39-25 |
| Gefahrenklasse | 4.3Skin Corr. 1BWater-react 2 |
| Verpackungsgruppe | I |
| Lagerklasse | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
Anwendungen & Verwendung
Verwenden
Tetrabutylammonium Borohydride is a strong reducing agent used in the synthesis of hyperbranched polyglycerol grafting on the surface of silica-coated nanoparticles.