HuagongsheHuagongshe Chemistry Print Report · For research reference only
Ethylenediamine diacetate
1,2-Ethanediamine, acetate (1:2) · Ethylenediamine diacetate · Ethanediammonium Diacetate · ethane-1,2-diaMine diacetate · aceticacid,ethane-1,2-diamine · EthylenediaMine diacetate 98% · ethyldiaminediacetic acidester
Identifiers & Physical Properties
| CAS No. | 38734-69-9 |
|---|---|
| Molecular formula | C6H16N2O4 |
| Average molar mass | 180.2 g/mol |
| Monoisotopic mass | 180.11100699 g/mol |
| SMILES | CC(=O)O.CC(=O)O.NCCN |
| InChIKey | SAXQBSJDTDGBHS-UHFFFAOYSA-N |
| PubChem CID | 10154317 |
| DTXSID | DTXSID10436235 |
Chemical & Physical Properties
| Topological polar surface area | 127 |
|---|---|
| Hydrogen bond donors | 4 |
| Hydrogen bond acceptors | 6 |
| Rotatable bonds | 1 |
| Heavy atoms | 12 |
| Formal charge | 0 |
| Complexity | 37 |
| Melting point | 118-120 °C(lit.) |
| Storage conditions | -20°C Freezer |
| Solubility | ChloroformDichloromethaneEthyl AcetateToluene |
| Physical state | Solid |
| Color | Off-White |
| BRN | 5444394 |
| InChI | InChI=1S/C2H8N2.C2H4O2/c3-1-2-41-2(3)4/h1-4H21H3,(H,3,4) |
| InChIKey | IENXJNLJEDMNTE-UHFFFAOYSA-N |
| SMILES | C(=O)(O)C.C(N)CN |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| Personal protective equipment (PPE) | Eyeshields, Gloves, type N95 (US) |
| Safety statements (S) | 22-24/25 |
| Water hazard class (WGK) | 3 |
| F | 9-21 |
| Storage class | 11 - Combustible Solids |
Safety & Regulations
| F | 9-21 |
|---|---|
| Personal protective equipment (PPE) | Eyeshields, Gloves, type N95 (US) |
| Water hazard class (WGK) | 3 |
| Safety statements (S) | 22-24/25 |
| Storage class | 11 - Combustible Solids |
Applications & Uses
Uses
1,2-Ethanediamine, acetate (1:2) is used as a catalyst for the preparation of various organic compounds such as methanodibenzodioxocin flavonoids, and chromeno-annulated cis-fused pyrano[3,4-c]benzopyran. It is also useful reagent for the synthesis of organic compunds such as arylmethyl nitrodihydroimidazopyridinium.