HuagongsheHuagongshe Chemistry Print Report · For research reference only
5-Aminoquinoline
QUINOLIN-5-AMINE · NSC 27982 · NSC 170619 · AKOS 212-43 · AKOS AUF01703 · 5-AminoquinoL · 5-QUINOLINAMINE · ASISCHEM Z74663
Identifiers & Physical Properties
| CAS No. | 611-34-7 |
|---|---|
| Molecular formula | C9H8N2 |
| Average molar mass | 144.17 g/mol |
| Monoisotopic mass | 144.06874826 g/mol |
| SMILES | Nc1cccc2ncccc12 |
| InChIKey | XMIAFAKRAAMSGX-UHFFFAOYSA-N |
| PubChem CID | 11911 |
| ChEMBL | CHEMBL100194 |
| EC No. | 210-266-1 |
| DTXSID | DTXSID80209978 |
Chemical & Physical Properties
| XLogP | 1.2 |
|---|---|
| Topological polar surface area | 38.9 |
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 0 |
| Heavy atoms | 11 |
| Formal charge | 0 |
| Complexity | 136 |
| Melting point | 106-109 °C (lit.) |
| Boiling point | 310 °C (lit.) |
| Density | 1.1148 (estimate) |
| Refractive index | 1.7080 (estimate) |
| Flash point | 310°C |
| Storage conditions | Keep in dark place,Inert atmosphere,Room temperature |
| Solubility | DMSO, Methanol |
| pKa (acidity coefficient) | pK1: 5.46(+1) (20°C,μ=0.01) |
| Physical state | Crystalline Powder or Granules |
| Color | White to slightly yellow |
| Sensitivity | Air Sensitive |
| BRN | 114479 |
| InChI | InChI=1S/C9H8N2/c10-8-4-1-5-9-7(8)3-2-6-11-9/h1-6H,10H2 |
| InChIKey | XMIAFAKRAAMSGX-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(N)C=CC=2)C=CC=1 |
| CAS DataBase Reference | 611-34-7(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | YYJ34Z13SH |
| NIST Chemistry Reference | 5-Quinolinamine(611-34-7) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319 |
| GHS precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xi |
| Risk statements (R) | 36/38-36/37/38 |
| Safety statements (S) | 26-36 |
| Water hazard class (WGK) | 3 |
| RTECS number | VA9625000 |
| F | 2-10 |
| Hazard Note | Harmful/Irritant/Air Sensitive |
| Hazard class | IRRITANTEye Irrit. 2Skin Irrit. 2 |
| Packing group | III |
| Customs code | 29334900 |
| Storage class | 11 - Combustible Solids |
Safety & Regulations
| F | 2-10 |
|---|---|
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| RTECS number | VA9625000 |
| Customs code | 29334900 |
| Risk statements (R) | 36/38-36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| hazard_note | Harmful/Irritant/Air Sensitive |
| Safety statements (S) | 26-36 |
| Hazard class | IRRITANTEye Irrit. 2Skin Irrit. 2 |
| Storage class | 11 - Combustible Solids |
| Packing group | III |
| GHS hazard statements | H315-H319 |
| GHS precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
Applications & Uses
Uses
Intermediate in the preparation of P2X7 antagonists
Preparation & Synthesis
Preparation
Under the catalysis of Pd/C, 95% ethanol was used as solvent to reduce 5-nitroquinoline with hydrazine hydrate to synthesize 5-aminoquinoline with a yield of 91.11%.