HuagongsheHuagongshe Chemistry Print Report · For research reference only
2-Propenamide, N,N'-1,2-ethanediylbis-
TECH. 90-95% · N,N'-(Ethane-1,2-diyl) · n,n'-ethylenebisacrylamide · BIS-ACRYLOYLETHYLENEDIAMINE · N,N'-Ethylenebis(acrylamide) · N,N'-ethanediyl-bis-acrylamid · N,N'-DIACRYLOYLETHYLENEDIAMINE · N,N'-DIMETHYLENEBIS-ACRYLAMIDE
Identifiers & Physical Properties
| CAS No. | 2956-58-3 |
|---|---|
| Molecular formula | C8H12N2O2 |
| Average molar mass | 168.19 g/mol |
| Monoisotopic mass | 168.08987762 g/mol |
| SMILES | C=CC(=O)NCCNC(=O)C=C |
| InChIKey | AYGYHGXUJBFUJU-UHFFFAOYSA-N |
| PubChem CID | 168964 |
| EC No. | 628-815-2 |
| DTXSID | DTXSID5025281 |
Chemical & Physical Properties
| XLogP | 0 |
|---|---|
| Topological polar surface area | 58.2 |
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 5 |
| Heavy atoms | 12 |
| Formal charge | 0 |
| Complexity | 177 |
| Melting point | 138-140 °C(lit.) |
| Boiling point | 456.3±41.0 °C(Predicted) |
| Density | 1.034 |
| Storage conditions | 2-8°C |
| pKa (acidity coefficient) | 14.07±0.46(Predicted) |
| Physical state | powder to crystal |
| Color | White to Almost white |
| Solubility | Soluble in water and methanol. |
| Sensitivity | Hygroscopic |
| BRN | 1771570 |
| InChI | InChI=1S/C8H12N2O2/c1-3-7(11)9-5-6-10-8(12)4-2/h3-4H,1-2,5-6H2,(H,9,11)(H,10,12) |
| InChIKey | AYGYHGXUJBFUJU-UHFFFAOYSA-N |
| SMILES | C(NC(=O)C=C)CNC(=O)C=C |
| CAS DataBase Reference | 2956-58-3(CAS DataBase Reference) |
| FDA UNII | 206L69E02O |
| UNSPSC Code | 12162002 |
| NACRES | NA.23 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xi,Xn,F |
| Risk statements (R) | 36/37/38-40-11 |
| Safety statements (S) | 26-36/37/39-20 |
| UN transport number | 1325 |
| Water hazard class (WGK) | 3 |
| F | 10 |
| Hazard class | 4.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Packing group | III |
| Customs code | 29241990 |
| Storage class | 11 - Combustible Solids |
Safety & Regulations
| GHS classification | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 72 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| F | 10 |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| UN transport number | 1325 |
| Customs code | 29241990 |
| Risk statements (R) | 36/37/38-40-11 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi,Xn,F |
| Safety statements (S) | 26-36/37/39-20 |
| Hazard class | 4.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Storage class | 11 - Combustible Solids |
| Packing group | III |
| Target organs | Respiratory system |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
Applications & Uses
Uses
N,N'-Ethylenebisacrylamide is used in the preparation of N,N'-dicinnamoyl-ethylendiamine using poly(N-octadecylacrylamide) as a catalyst. It is also used as an intermediate in pharmaceutical industries.