HuagongsheHuagongshe Chemistry Print Report · For research reference only
Triisopropanolamine Borate
borester21 · 9-Trioxa-5-a · Triisopropylamine-borate · TRIISOPROPANOLAMINE CYCLIC BORATE · 1,1’,1’’-nitrilotri-2-propanoborate · boricacid,tris(1-amino-2-propyl)ester · Triisopropanolamine cyclic borate, 98+% · 1,1’,1’’-nitrilotri-2-propanocyclicborate
Identifiers & Physical Properties
| CAS No. | 101-00-8 |
|---|---|
| Molecular formula | C9H18BNO3 |
| Average molar mass | 199.06 g/mol |
| Monoisotopic mass | 199.13797384 g/mol |
| SMILES | CC1CN2CC(C)OB(O1)OC(C)C2 |
| InChIKey | IWKGJTDSJPLUCE-UHFFFAOYSA-N |
| PubChem CID | 225550 |
| EC No. | 811-143-0 |
| DTXSID | DTXSID50905879 |
Chemical & Physical Properties
| Topological polar surface area | 30.9 |
|---|---|
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 4 |
| Rotatable bonds | 0 |
| Heavy atoms | 14 |
| Formal charge | 0 |
| Complexity | 171 |
| Melting point | 150 °C |
| Boiling point | 135°C/0.2mmHg(lit.) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| Solubility | soluble in Acetone |
| pKa (acidity coefficient) | 6.52±0.70(Predicted) |
| Physical state | Crystalline Chunks and Needles |
| Color | White to light yellow |
| InChI | InChI=1S/C9H18BNO3/c1-7-4-11-5-8(2)13-10(12-7)14-9(3)6-11/h7-9H,4-6H2,1-3H3 |
| InChIKey | IWKGJTDSJPLUCE-UHFFFAOYSA-N |
| SMILES | B12OC(C)CN(CC(C)O1)CC(C)O2 |
| CAS DataBase Reference | 101-00-8(CAS DataBase Reference) |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H320 |
| GHS precautionary statements | P264-P305+P351+P338+P337+P313 |
| Safety statements (S) | 24/25 |
| RTECS number | ED5787000 |
| Customs code | 29163990 |
Safety & Regulations
| GHS classification | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P264+P265, P280, P305+P351+P338, and P337+P317 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Eye Irrit. 2 (100%) |
| RTECS number | ED5787000 |
| Customs code | 29163990 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Safety statements (S) | 24/25 |
| GHS hazard statements | H320 |
| GHS precautionary statements | P264-P305+P351+P338+P337+P313 |
Applications & Uses
Uses
Triisopropanolamine cyclic borate can be used as a gasoline corrosion inhibitor, metal working fluid, gasoline dehydrating agent, polysiloxane elastic rubber stabilizer, adhesive, and polymer crosslinking agent.