7-Nitroindole
7-NITRO-1H-INDOLE · 7-N · NSC 69874 · 7-nitro-indol · 7-NITROINDOLE · 7-Nitroindole>7-Nitroindole,97% · 7-Nitroindole,99% · 1H-Indole,7-nitro-
Identifiers & Physical Properties
| CAS No. | 6960-42-5 |
|---|---|
| Molecular formula | C8H6N2O2 |
| Average molar mass | 162.15 g/mol |
| Monoisotopic mass | 162.04292743 g/mol |
| SMILES | O=[N+]([O-])c1cccc2cc[nH]c12 |
| InChIKey | LZJGQIVWUKFTRD-UHFFFAOYSA-N |
| PubChem CID | 23396 |
| ChEMBL | CHEMBL164632 |
| EC No. | 677-504-8 |
| DTXSID | DTXSID20219879 |
Chemical & Physical Properties
| XLogP | 2.6 |
|---|---|
| Topological polar surface area | 61.6 |
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 0 |
| Heavy atoms | 12 |
| Formal charge | 0 |
| Complexity | 190 |
| SpringerMaterials Properties | Chemical shift |
| LogP (partition coefficient) | 2.63 |
| Melting point | 94-98 °C (lit.) |
| Boiling point | 288.82°C (rough estimate) |
| Density | 1.3264 (rough estimate) |
| Refractive index | 1.5770 (estimate) |
| Storage conditions | Sealed in dry,Room Temperature |
| Physical state | powder to crystal |
| pKa (acidity coefficient) | 13.96±0.30(Predicted) |
| Color | Light yellow to Yellow to Orange |
| Solubility | slightly soluble |
| BRN | 130874 |
| InChI | InChI=1S/C8H6N2O2/c11-10(12)7-3-1-2-6-4-5-9-8(6)7/h1-5,9H |
| InChIKey | LZJGQIVWUKFTRD-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2[N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 6960-42-5(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS08 |
| Signal word | Warning |
| GHS hazard statements | H341 |
| GHS precautionary statements | P201-P202-P280-P308+P313-P405-P501a |
| Personal protective equipment (PPE) | Eyeshields, Gloves |
| Hazard symbols | Xn,Xi |
| Risk statements (R) | 68 |
| Safety statements (S) | 36/37-45 |
| Water hazard class (WGK) | 3 |
| RTECS number | NM1169000 |
| Hazard Note | Irritant |
| Hazard class | IRRITANT-HARMFUL |
| Customs code | 29339900 |
| Storage class | 11 - Combustible Solids |
Safety & Regulations
| GHS classification | WarningH302 (12.5%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (12.5%) |
| Personal protective equipment (PPE) | Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| RTECS number | NM1169000 |
| Customs code | 29339900 |
| Risk statements (R) | 68 |
| Signal word | Warning |
| GHS pictogram | GHS08 |
| Hazard symbols | Xn,Xi |
| hazard_note | Irritant |
| Safety statements (S) | 36/37-45 |
| Hazard class | IRRITANT-HARMFUL |
| Storage class | 11 - Combustible Solids |
| GHS hazard statements | H341 |
| GHS precautionary statements | P201-P202-P280-P308+P313-P405-P501a |
Applications & Uses
Uses
7-Nitroindole is a reagent used in chemical synthesis. It has been used in the synthesis of protein kinase and inosine monophosphate inhibitors, beta3 agonists and CCK-1 receptor modulators. 7-Nitroindole has also been used as a photochemical precursor of the 2'-deoxyribonolactone analog.
Uses
7-Nitroindole is a useful reactant for the preparation of various compounds and inhibitors.
Uses
Reactant for preparation of:Protein kinase inhibitorsPotential fructose 1,6-bisphosphatase inhibitorsFactor Xa inhibitorsAntagonist of the mineralocorticoid receptorAntitumor sulfonamidesInosine monophosphate dehydrogenase (IMPDH) inhibitorsSubtype-selective cyclooxygenase (COX) inhibitorsThrombin protease-activated receptor (PAR-1) ligands