HuagongsheHuagongshe Chemistry Print Report · For research reference only
Nickel(2+) hydrogen citrate
nickel(2+) hydrogen citrate
Identifiers & Physical Properties
| CAS No. | 18721-51-2 |
|---|---|
| Molecular formula | C6H6NiO7 |
| Average molar mass | 248.8 g/mol |
| Monoisotopic mass | 247.94669543 g/mol |
| SMILES | O=C([O-])CC(O)(CC(=O)O)C(=O)[O-].[Ni+2] |
| InChIKey | PVQDBEUVVVTFSY-UHFFFAOYSA-L |
| PubChem CID | 23615267 |
| EC No. | 242-533-3 |
| DTXSID | DTXSID501029294 |
Chemical & Physical Properties
| Topological polar surface area | 138 |
|---|---|
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 7 |
| Rotatable bonds | 3 |
| Heavy atoms | 14 |
| Formal charge | 0 |
| Complexity | 234 |
| Density | 1.85g/cm3 at 21.9℃ |
| Vapor pressure | 0-0Pa at 20-25℃ |
| Physical state | Powder |
| Surface tension | 59.84-61.93mN/m at 1g/L and 20-20.2℃ |
| REACH Annex XVII Substances List | Nickel(2+) hydrogen citrate (18721-51-2) |
| GHS pictogram | GHS08,GHS09 |
| Signal word | Danger |
| GHS hazard statements | H317-H334-H350i-H372-H410-H341-H360D |
| GHS precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P260-P264-P270-P314-P501-P201-P202-P281-P308+P313-P405-P501-P261-P285-P304+P341-P342+P311-P501-P273-P391-P501 |
| REACH registrations | Active |
Safety & Regulations
| GHS classification | DangerH317: May cause an allergic skin reaction [Warning Sensitization, Skin]P203, P233, P260, P261, P264, P270, P271, P272, P273, P280, P284, P302+P352, P304+P340, P318, P319, P321, P333+P317, P342+P316, P362+P364, P391, P403, P405, and P501 (click each P-code to see the statement)H290 (100%): May be corrosive to metals [Warning Corrosive to Metals]P203, P233, P234, P260, P261, P264, P264+P265, P270, P271, P272, P273, P280, P284, P301+P317, P302+P352, P304+P340, P305+P351+P338, P318, P319, P321, P330, P332+P317, P333+P317, P337+P317, P342+P316, P362+P364, P390, P391, P403, P405, P406, and P501 (click each P-code to see the statement) |
|---|---|
| Regulatory information | Chemical: 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, nickel(2+) salt (1:1)Hazard Traits - CarcinogenicityReproductive ToxicityRespiratory ToxicityREACH registered substance: Nickel(2+) hydrogen citrate (EC: 242-533-3)Restricted substance: Nickel(2+) hydrogen citrate |
| Hazard Classes and Categories | Met. Corr. 1 (100%)Carc. 1A |
| Signal word | Danger |
| GHS pictogram | GHS08,GHS09 |
| GHS hazard statements | H317-H334-H350i-H372-H410-H341-H360D |
| REACH registrations | Active |
| GHS precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P260-P264-P270-P314-P501-P201-P202-P281-P308+P313-P405-P501-P261-P285-P304+P341-P342+P311-P501-P273-P391-P501 |