HuagongsheHuagongshe Chemistry Print Report · For research reference only
3-Cyanophenylboronic acid
1-p-Tolylpyrazole-4-boronic acid · 2-Methyl-3-nitrophenylboronic acid, pinacol ester · 4,4,5,5-Tetramethyl-2-(4-methyl-3-nitrophenyl)-1,3,2-dioxaborolane · 2-(3-Chloro-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane · AKOS BRN-0075 · CAS:150255-96-2 · RARECHEM AH PB 0207 · 3-Cyanophenylboronic
Identifiers & Physical Properties
| CAS No. | 150255-96-2 |
|---|---|
| Molecular formula | C7H6BNO2 |
| Average molar mass | 146.94 g/mol |
| Monoisotopic mass | 147.04915883 g/mol |
| SMILES | N#Cc1cccc(B(O)O)c1 |
| InChIKey | XDBHWPLGGBLUHH-UHFFFAOYSA-N |
| PubChem CID | 2734325 |
| ChEMBL | CHEMBL485740 |
| EC No. | 604-729-0 |
| DTXSID | DTXSID60370216 |
Chemical & Physical Properties
| Topological polar surface area | 64.3 |
|---|---|
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 3 |
| Rotatable bonds | 1 |
| Heavy atoms | 11 |
| Formal charge | 0 |
| Complexity | 175 |
| Melting point | 298 °C (dec.) (lit.) |
| Boiling point | 347.4±44.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| Storage conditions | Keep in dark place,Sealed in dry,Room Temperature |
| Solubility | soluble in Methanol |
| pKa (acidity coefficient) | 7.17±0.10(Predicted) |
| Physical state | solid |
| Color | White to Light yellow |
| BRN | 6136720 |
| InChI | InChI=1S/C7H6BNO2/c9-5-6-2-1-3-7(4-6)8(10)11/h1-4,10-11H |
| InChIKey | XDBHWPLGGBLUHH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC(C#N)=C1)(O)O |
| CAS DataBase Reference | 150255-96-2(CAS DataBase Reference) |
| UNSPSC Code | 12352106 |
| NACRES | NA.22 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H302-H315-H319-H335 |
| GHS precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xi,C,Xn |
| Risk statements (R) | 36/37/38-34-36-41-37/38-22 |
| Safety statements (S) | 26-37/39-45-36/37/39-22-39-36 |
| UN transport number | UN3439 |
| Water hazard class (WGK) | 3 |
| Hazard Note | Harmful/Irritant |
| Hazard class | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Packing group | III |
| Customs code | 29163990 |
| Storage class | 11 - Combustible Solids |
| REACH registrations | Active |
Safety & Regulations
| GHS classification | This chemical does not meet GHS hazard criteria for 7.4% (4 of 54) of reports.WarningH302 (20.4%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 54 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatory information | Status: Active Update: 27-10-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/33068 |
| Hazard Classes and Categories | Acute Tox. 4 (20.4%) |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| UN transport number | UN3439 |
| Customs code | 29163990 |
| Risk statements (R) | 36/37/38-34-36-41-37/38-22 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi,C,Xn |
| hazard_note | Harmful/Irritant |
| Safety statements (S) | 26-37/39-45-36/37/39-22-39-36 |
| Hazard class | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Storage class | 11 - Combustible Solids |
| Packing group | III |
| Target organs | Respiratory system |
| GHS hazard statements | H302-H315-H319-H335 |
| REACH registrations | Active |
| GHS precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
Applications & Uses
Uses
suzuki reaction
Uses
3-Cyanophenylboronic acid can be used:As an intermediate in the synthesis of piperidine-based MCH R1 antagonists.As a substrate in the Suzuki coupling reactions to prepare 4-aryl-1,8-naphthyridin-2(1H)-ones.As an intermediate in the synthesis of biaryl-basedphenylalanineamino acid analogs, which are used as kainate receptors ligands.To prepare phenylimidazole-basedIr(III) complexes for phosphorescent blue OLED applications.