HuagongsheHuagongshe Chemistry Print Report · For research reference only
(3R)-(+)-3-(Dimethylamino)pyrrolidine
(R)-N,N-dimethylpyrrolidin-3-amine · (3R)-N · JACS-132958-72-6 · (3R)-(+)-3-(DIMETHYL · (3R)-3-DIMETHYLAMINOPYRROLIDINE · (R)-3-(DIMETHYLAMINO)PYRROLIDINE · R- N,N-diMethyl-3-PyrrolidinaMine · (R)-DIMETHYL-PYRROLIDIN-3-YL-AMINE
Identifiers & Physical Properties
| CAS No. | 132958-72-6 |
|---|---|
| Molecular formula | C6H14N2 |
| Average molar mass | 114.19 g/mol |
| Monoisotopic mass | 114.11569845 g/mol |
| SMILES | CN(C)[C@@H]1CCNC1 |
| InChIKey | AVAWMINJNRAQFS-ZCFIWIBFSA-N |
| PubChem CID | 2758521 |
| EC No. | 626-139-2 |
| DTXSID | DTXSID50374369 |
Chemical & Physical Properties
| XLogP | 0 |
|---|---|
| Topological polar surface area | 15.3 |
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 1 |
| Heavy atoms | 8 |
| Formal charge | 0 |
| Complexity | 70.9 |
| Boiling point | 166 °C760 mm Hg(lit.) |
| Density | 0.899 g/mL at 25 °C(lit.) |
| Refractive index | n20/D 1.4650(lit.) |
| Flash point | 125 °F |
| Storage conditions | under inert gas (nitrogen or Argon) at 2–8 °C |
| Physical state | clear liquid |
| pKa (acidity coefficient) | 9.93±0.10(Predicted) |
| Color | Colorless to Light yellow |
| optical activity | [α]20/D +14°, c = 1 in ethanol |
| Sensitivity | Air Sensitive |
| InChI | InChI=1S/C6H14N2/c1-8(2)6-3-4-7-5-6/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | AVAWMINJNRAQFS-ZCFIWIBFSA-N |
| SMILES | N1CC[C@@H](N(C)C)C1 |
| CAS DataBase Reference | 132958-72-6(CAS DataBase Reference) |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
| GHS pictogram | GHS02,GHS05,GHS07 |
| Signal word | Danger |
| GHS hazard statements | H226-H302-H315-H318-H335 |
| GHS precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard symbols | Xn |
| Risk statements (R) | 10-22-37/38-41-38-37 |
| Safety statements (S) | 26-36/39-39-36 |
| UN transport number | UN 1993 3/PG 3 |
| Water hazard class (WGK) | 2 |
| Hazard class | 3Acute Tox. 4 OralEye Dam. 1Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Packing group | III |
| Customs code | 29339900 |
| Storage class | 3 - Flammable liquids |
| Limited quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
Safety & Regulations
| GHS classification | DangerH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P354+P338, P316, P317, P319, P321, P330, P332+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 48 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| Personal protective equipment (PPE) | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Water hazard class (WGK) | 2 |
| UN transport number | UN 1993 3/PG 3 |
| Customs code | 29339900 |
| Risk statements (R) | 10-22-37/38-41-38-37 |
| Signal word | Danger |
| GHS pictogram | GHS02,GHS05,GHS07 |
| Hazard symbols | Xn |
| Safety statements (S) | 26-36/39-39-36 |
| Hazard class | 3Acute Tox. 4 OralEye Dam. 1Flam. Liq. 3Skin Irrit. 2STOT SE 3 |
| Storage class | 3 - Flammable liquids |
| Packing group | III |
| Target organs | Respiratory system |
| GHS hazard statements | H226-H302-H315-H318-H335 |
| Limited quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
| GHS precautionary statements | P210-P233-P280-P301+P312-P303+P361+P353-P305+P351+P338 |