HuagongsheHuagongshe Chemistry Print Report · For research reference only
(+-)-4-Hydroxymandelic acid
2-hydroxy-2-(4-hydroxyphenyl)acetic acid · 2-hydroxy-2-(4-hydroxyphenyl)acetic acid hydrate · RARECHEM AL BO 0522 · P-HYDROXY MANDELIC ACID · 4-HYDROXYM AND ELIC ACID · DL-4-HYDROXYMANDELIC ACID · 4-Hydroxyphenylglycolic acid · DL-4-Hydroxymandelic acid,95%
Identifiers & Physical Properties
| CAS No. | 1198-84-1 |
|---|---|
| Molecular formula | C8H8O4 |
| Average molar mass | 168.15 g/mol |
| Monoisotopic mass | 168.04225873 g/mol |
| SMILES | O=C(O)C(O)c1ccc(O)cc1 |
| InChIKey | YHXHKYRQLYQUIH-UHFFFAOYSA-N |
| PubChem CID | 328 |
| ChEMBL | CHEMBL2087618 |
| ChEBI | CHEBI:16388 |
| EC No. | 214-839-7 |
| DTXSID | DTXSID70862596 |
Chemical & Physical Properties
| XLogP | 0.3 |
|---|---|
| Topological polar surface area | 77.8 |
| Hydrogen bond donors | 3 |
| Hydrogen bond acceptors | 4 |
| Rotatable bonds | 2 |
| Heavy atoms | 12 |
| Formal charge | 0 |
| Complexity | 160 |
| Melting point | 82-85 °C(lit.) |
| Boiling point | 405.4±30.0 °C(Predicted) |
| Density | 1.480±0.06 g/cm3(Predicted) |
| Storage conditions | Store at -20°C |
| Solubility | Soluble in DMSO |
| Physical state | Solid |
| pKa (acidity coefficient) | 3.51±0.10(Predicted) |
| Color | White to pink |
| InChI | InChI=1S/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12) |
| InChIKey | YHXHKYRQLYQUIH-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(C1=CC=C(O)C=C1)O |
| CAS DataBase Reference | 1198-84-1(CAS DataBase Reference) |
| FDA UNII | HV52GS53BA |
| EPA Substance Registry System | Benzeneacetic acid, ?,4-dihydroxy- (1198-84-1) |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P305+P351+P338 |
| Hazard symbols | Xi |
| Risk statements (R) | 36/37/38 |
| Safety statements (S) | 26-36 |
| Water hazard class (WGK) | 3 |
Safety & Regulations
| Water hazard class (WGK) | 3 |
|---|---|
| Risk statements (R) | 36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| Safety statements (S) | 26-36 |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P305+P351+P338 |
Applications & Uses
Uses
4-Hydroxymandelic Acid is a useful synthetic intermediate in the synthesis of Hydroxyatenolol (H802480); a metabolite of Atenolol (A790075) which is a cardioselective β-adrenergic blocker, antihypertensive, antianginal, and antiarrhythmic (class II).