HuagongsheHuagongshe Chemistry Print Report · For research reference only
5-Phenyl-2-trityltetrazole
5-Phenyl-2-trityltetrazole · 2-trityl-5-phenyl-2H-tetrazole · 5-phenyl-2-trityl-2H-tetrazole · 5-Phenyl-2-(triphenylMethyl)-2H-tetrazole · 2H-Tetrazole, 5-phenyl-2-(triphenylmethyl)-
Identifiers & Physical Properties
| CAS No. | 87268-78-8 |
|---|---|
| Molecular formula | C26H20N4 |
| Average molar mass | 388.5 g/mol |
| Monoisotopic mass | 388.16879664 g/mol |
| SMILES | c1ccc(-c2nnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)cc1 |
| InChIKey | HOCMARZVAUWOFA-UHFFFAOYSA-N |
| PubChem CID | 3292959 |
| ChEMBL | CHEMBL5011603 |
| DTXSID | DTXSID30391135 |
Chemical & Physical Properties
| XLogP | 6.6 |
|---|---|
| Topological polar surface area | 43.6 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 3 |
| Rotatable bonds | 5 |
| Heavy atoms | 30 |
| Formal charge | 0 |
| Complexity | 468 |
| Boiling point | 586.1±60.0 °C(Predicted) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| Solubility | Chloroform, Dichloromethane, Methanol, Tetrahydrofuran |
| pKa (acidity coefficient) | 0.00±0.12(Predicted) |
Applications & Uses
Uses
An intermediate in the synthesis of Losartan