2-Amino-6-chloropurine
2-AMINO-6-CHLOROPURINE · 6-Chloro-7H-purin-2-amine · 2-amino-6-chloro-purin · 6-CHLORO-2-AMINOPURINE · 9H-PURIN-2-AMINE, 6-CHLORO- · 2-AMINO-6-CHLOROPURINE (2A6ClP) · AURORA KA-689 · 6-CHLOROGUANINE
Identifiers & Physical Properties
| CAS No. | 10310-21-1 |
|---|---|
| Molecular formula | C5H4ClN5 |
| Average molar mass | 169.57 g/mol |
| Monoisotopic mass | 169.01552281 g/mol |
| SMILES | Nc1nc(Cl)c2[nH]cnc2n1 |
| InChIKey | RYYIULNRIVUMTQ-UHFFFAOYSA-N |
| PubChem CID | 5360349 |
| ChEMBL | CHEMBL226396 |
| ChEBI | CHEBI:72345 |
| EC No. | 233-686-7 |
| DTXSID | DTXSID9074432 |
Chemical & Physical Properties
| XLogP | 0.4 |
|---|---|
| Topological polar surface area | 80.5 |
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 4 |
| Rotatable bonds | 0 |
| Heavy atoms | 11 |
| Formal charge | 0 |
| Complexity | 154 |
| Melting point | >300 °C (lit.) |
| Boiling point | 279.76°C (rough estimate) |
| Density | 1.4937 (rough estimate) |
| Refractive index | 1.6110 (estimate) |
| Storage conditions | 2-8°C |
| Solubility | Solubility in 1mol/L NaOH1.7 g/L (20 ºC) |
| Physical state | Powder |
| pKa (acidity coefficient) | 6.65±0.20(Predicted) |
| Color | White to yellow |
| BRN | 9626 |
| InChI | InChI=1S/C5H4ClN5/c6-3-2-4(9-1-8-2)11-5(7)10-3/h1H,(H3,7,8,9,10,11) |
| InChIKey | RYYIULNRIVUMTQ-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC(N)=NC=2Cl)NC=1 |
| CAS DataBase Reference | 10310-21-1(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | 83V03P835E |
| EPA Substance Registry System | 6-Chloro-2-aminopurine (10310-21-1) |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P201-P202-P261-P264b-P271-P280i-P302+P352-P304+P340-P305+P351+P338-P308+P313-P332+P313-P362+P364-P403+P233-P501c |
| Personal protective equipment (PPE) | Eyeshields, Gloves, type N95 (US) |
| Hazard symbols | Xi,Xn |
| Risk statements (R) | 20/21/22-36/37/38 |
| Safety statements (S) | 22-24/25-36-26 |
| Water hazard class (WGK) | 3 |
| RTECS number | UO7502000 |
| F | 10 |
| Hazard Note | Irritant/Keep Cold |
| Hazard class | IRRITANT, KEEP COLD |
| Customs code | 29339900 |
| Storage class | 11 - Combustible Solids |
Safety & Regulations
| GHS classification | Not ClassifiedAggregated GHS information provided per 42 reports by companies from 6 notifications to the ECHA C&L Inventory. |
|---|---|
| Regulatory information | 1H-Purin-2-amine, 6-chloro-: Does not have an individual approval but may be used under an appropriate group standard |
| Hazard Classes and Categories | Not Classified |
| F | 10 |
| Personal protective equipment (PPE) | Eyeshields, Gloves, type N95 (US) |
| Water hazard class (WGK) | 3 |
| RTECS number | UO7502000 |
| Customs code | 29339900 |
| Risk statements (R) | 20/21/22-36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi,Xn |
| hazard_note | Irritant/Keep Cold |
| Safety statements (S) | 22-24/25-36-26 |
| Hazard class | IRRITANT, KEEP COLD |
| Storage class | 11 - Combustible Solids |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P201-P202-P261-P264b-P271-P280i-P302+P352-P304+P340-P305+P351+P338-P308+P313-P332+P313-P362+P364-P403+P233-P501c |
Applications & Uses
Description
6-Chloroguanine, also be known as 2-Amino-6-chloropurine may be used in the enzymatic synthesis of 2′-deoxyguanosine, 9-alkyl purines (R)and (S)-N(2-phosphonomethoxypropyl) derivatives of purine and pyrimidine bases. It is also useful during the synthesis of guanine.
Description
2-Amino-6-chloropurine is a precursor in the synthesis of nucleoside analogs with antiviral activity against Epstein-Barr virus (EBV) and human herpes virus 6 (HHV-6).
Uses
2-Amino-6-chloropurine finds its uses in the enzymatic synthesis of 2-deoxyguanosine, 9-alkyl purines and (R)- and (S)-N-(2-phosphonomethoxypropyl) derivatives of purine and pyrimidine bases.
Uses
2-Amino-6-chloropurine may be used:in the enzymatic synthesis of 2′-deoxyguanosinein the synthesis of 9-alkyl purinesin the synthesis of (R)- and (S)-N-(2-phosphonomethoxypropyl) derivatives of purine and pyrimidine bases
General Description
2-Amino-6-chloropurine is a 6-substituted purine. Tautomeric purine forms of 2-amino-6-chloropurine were investigated by vibrational spectroscopy and quantum chemical method.