7-Hydroxy-4-trifluoromethylcoumarin
7-HYDROXY-4-(TRIFLUOROMETHYL)-2H-CHROMEN-2-ONE · TFMU · BUTTPARK 20\02-70 · TFMU, Coumarin 174 · TIMTEC-BB SBB006559 · Acenocoumarol Impurity 51 · TRIFLUOROMETHYLUMBELLIFERONE · 4-(TRIFLUOROMETHYL)UMBELLIFERON
Identifiers & Physical Properties
| CAS No. | 575-03-1 |
|---|---|
| Molecular formula | C10H5F3O3 |
| Average molar mass | 230.14 g/mol |
| Monoisotopic mass | 230.01907868 g/mol |
| SMILES | O=c1cc(C(F)(F)F)c2ccc(O)cc2o1 |
| InChIKey | CCKWMCUOHJAVOL-UHFFFAOYSA-N |
| PubChem CID | 5375667 |
| ChEMBL | CHEMBL104679 |
| EC No. | 624-706-9 |
| DTXSID | DTXSID80206109 |
Chemical & Physical Properties
| XLogP | 2.4 |
|---|---|
| Topological polar surface area | 46.5 |
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 6 |
| Rotatable bonds | 0 |
| Heavy atoms | 16 |
| Formal charge | 0 |
| Complexity | 335 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Melting point | 178-180 °C (lit.) |
| Boiling point | 311.4±42.0 °C(Predicted) |
| Density | 1.4435 (estimate) |
| Storage conditions | Sealed in dry,Room Temperature |
| Solubility | DMF: soluble |
| Physical state | powder to crystal |
| pKa (acidity coefficient) | 7.23±0.20(Predicted) |
| Color | White to Light yellow to Light orange |
| λmax | 330nm(Toluene)(lit.) |
| BRN | 210932 |
| InChI | InChI=1S/C10H5F3O3/c11-10(12,13)7-4-9(15)16-8-3-5(14)1-2-6(7)8/h1-4,14H |
| InChIKey | CCKWMCUOHJAVOL-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 575-03-1(CAS DataBase Reference) |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
| GHS pictogram | GHS06 |
| Signal word | Danger |
| GHS hazard statements | H300-H315-H319-H335 |
| GHS precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard symbols | Xi,T |
| Risk statements (R) | 36/37/38-25 |
| Safety statements (S) | 26-36-45 |
| UN transport number | UN 2811 6.1/PG 3 |
| Water hazard class (WGK) | 3 |
| F | 8-10 |
| Hazard class | IRRITANTAcute Tox. 2 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Customs code | 29322090 |
| Storage class | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
Safety & Regulations
| GHS classification | DangerH300 (91.9%): Fatal if swallowed [Danger Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P316, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 74 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 2 (91.9%) |
| F | 8-10 |
| Personal protective equipment (PPE) | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Water hazard class (WGK) | 3 |
| UN transport number | UN 2811 6.1/PG 3 |
| Customs code | 29322090 |
| Risk statements (R) | 36/37/38-25 |
| Signal word | Danger |
| GHS pictogram | GHS06 |
| Hazard symbols | Xi,T |
| Safety statements (S) | 26-36-45 |
| Hazard class | IRRITANTAcute Tox. 2 OralEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Storage class | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
| Target organs | Respiratory system |
| GHS hazard statements | H300-H315-H319-H335 |
| GHS precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
Applications & Uses
Description
7-Hydroxy-4-(trifluoromethyl)coumarin can be used as a reference standard for fluorescent pH indicator.
Uses
Suitable as pH-indicator. Trifluoromethylumbelliferone is a slightly longer wavelength analog of 4-methylcoumarin (4-MU) with a pKa that more closely matches physiological pH values.
Uses
7-Hydroxy-4-(trifluoromethyl)coumarin is an halogenated metabolite of Coumarin (C755380), an naturally occurring organic compound that exists in many plants. Coumarin is the precursor molecule in the synthesis of various synthetic anti-coagulant such as warfarin (W498500)/.
General Description
7-Hydroxy-4-(trifluoromethyl)coumarin is a class of 7-hydroxycoumarin that is majorly used as laser dyes. It has a characterized emission spectra and may be used in excited state proton transfer (ESPT).