2,2-Difluoro-1,3-benzodioxole
2,2-difluorobenzo[d][1,3]dioxole · 2,2-Difluoro-2H-1,3-benzodioxole · 2,2-Difluoro-1,3-ben · uoro-1,3-benzodioxoL · 2,2-Difluorochalcone · LABOTEST-BB LT01148491 · 2,2-DIFLUOROBENZODIOXOLE · 2,2-Difluoro-1,3-benzodixole
Identifiers & Physical Properties
| CAS No. | 1583-59-1 |
|---|---|
| Molecular formula | C7H4F2O2 |
| Average molar mass | 158.1 g/mol |
| Monoisotopic mass | 158.01793581 g/mol |
| SMILES | FC1(F)Oc2ccccc2O1 |
| InChIKey | DGCOGZQDAXUUBY-UHFFFAOYSA-N |
| PubChem CID | 74103 |
| EC No. | 216-431-4 |
| DTXSID | DTXSID60166398 |
Chemical & Physical Properties
| XLogP | 2.5 |
|---|---|
| Topological polar surface area | 18.5 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 4 |
| Rotatable bonds | 0 |
| Heavy atoms | 11 |
| Formal charge | 0 |
| Complexity | 145 |
| PFAS | PFAS -> PFAS identified in REACH Regulation EC No. 1272/2008 |
| Boiling point | 129-130°C |
| Density | 1,308 g/cm3 |
| Refractive index | 1.443 |
| Flash point | 129-130°C |
| Storage conditions | 2-8°C |
| Solubility | Chloroform, Methanol |
| Physical state | Oil |
| Color | Clear Colourless |
| BRN | 1307648 |
| InChI | InChI=1S/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
| InChIKey | DGCOGZQDAXUUBY-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OC1(F)F |
| LogP (partition coefficient) | 2.96 |
| CAS DataBase Reference | 1583-59-1(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H317-H319-H335 |
| GHS precautionary statements | P280-P302+P352-P305+P351+P338 |
| Hazard symbols | Xi |
| Risk statements (R) | 36/37/38-43 |
| Safety statements (S) | 26-36/37/39-36/37 |
| UN transport number | UN1993 |
| Water hazard class (WGK) | 3 |
| Hazard Note | Irritant |
| Hazard class | 3Flam. Liq. 3Skin Irrit. 2Skin Sens. 1 |
| Packing group | III |
| Customs code | 2932990090 |
| Storage class | 3 - Flammable liquids |
| REACH registrations | Active |
| Limited quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
Safety & Regulations
| GHS classification | WarningH226 (67.2%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P272, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P333+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 116 reports by companies from 10 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Regulatory information | Status: Active Update: 07-03-2016 https://echa.europa.eu/registration-dossier/-/registered-dossier/11884 |
| Hazard Classes and Categories | Flam. Liq. 3 (67.2%) |
| Water hazard class (WGK) | 3 |
| UN transport number | UN1993 |
| Customs code | 2932990090 |
| Risk statements (R) | 36/37/38-43 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| hazard_note | Irritant |
| Safety statements (S) | 26-36/37/39-36/37 |
| Hazard class | 3Flam. Liq. 3Skin Irrit. 2Skin Sens. 1 |
| Storage class | 3 - Flammable liquids |
| Packing group | III |
| GHS hazard statements | H315-H317-H319-H335 |
| Limited quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
| REACH registrations | Active |
| GHS precautionary statements | P280-P302+P352-P305+P351+P338 |
Applications & Uses
Uses
2,2-Difluoro-1,3-benzodioxole is an intermediate compound which is used especially for the preparation of products for agricultural chemistry and for the synthesis of pharmaceutical products. 2,2-difluoro-1,3-benzodioxole is a useful difluoromethylated building block for the synthesis of various benzodioxole-containing pharmaceutical active compounds. 2-,3-,and 4-(Trifluoromethoxy)phenyllithiums: Versatile intermediates offering access to a variety of new organofluorine compounds. Selective aliphatic fluorination by halogen exchange in mild conditions.
Uses
2,2-Difluoro-1,3-benzodioxole is used in the synthesis of Kv3 inhibitors as well as in the preparation of renin inhibitors.
Preparation & Synthesis
Preparation
2,2-Difluoro-1,3-benzodioxole is prepared by reaction of 2,2-dichloro-1,3-benzodioxole with potassium fluoride in the presence of an effective quantity of a catalyst selected from potassium hydrogen fluoride, sodium hydrogen fluoride, cesium hydrogen fluoride, rubidium hydrogen fluoride, and quaternary ammonium hydrogen fluoride. https://patents.google.com/patent/US5432290A/en