HuagongsheHuagongshe Chemistry Print Report · For research reference only
1-(p-Toluenesulfonyl)imidazole
1-(P-TOLUENESULFONYL)IMIDAZOLE · 1-Tosyl-1H-imidazole · 1-(p-toluenesulphonyl)imidazole · TosI · Tosylimidazole · 1-TOSYLIMIDAZOLE · 1-(p-Toluenesulfonyl · 1-(4-Tolylsulfonyl)imidazole
Identifiers & Physical Properties
| CAS No. | 2232-08-8 |
|---|---|
| Molecular formula | C10H10N2O2S |
| Average molar mass | 222.27 g/mol |
| Monoisotopic mass | 222.04629856 g/mol |
| SMILES | Cc1ccc(S(=O)(=O)n2ccnc2)cc1 |
| InChIKey | YJYMYJRAQYREBT-UHFFFAOYSA-N |
| PubChem CID | 75219 |
| EC No. | 218-771-9 |
| DTXSID | DTXSID6022181 |
Chemical & Physical Properties
| XLogP | 1.6 |
|---|---|
| Topological polar surface area | 60.3 |
| Hydrogen bond donors | 0 |
| Hydrogen bond acceptors | 3 |
| Rotatable bonds | 2 |
| Heavy atoms | 15 |
| Formal charge | 0 |
| Complexity | 302 |
| Melting point | 76-78 °C(lit.) |
| Boiling point | 409.1±38.0 °C(Predicted) |
| Density | 1.3038 (rough estimate) |
| Refractive index | 1.5650 (estimate) |
| Storage conditions | Inert atmosphere,Room Temperature |
| Solubility | chloroform: soluble25mg/mL, clear, colorless to faintly yellow |
| Physical state | Crystals or Crystalline Powder |
| pKa (acidity coefficient) | 1.22±0.10(Predicted) |
| Color | White to slightly yellow |
| Sensitivity | Moisture Sensitive |
| BRN | 612451 |
| InChI | InChI=1S/C10H10N2O2S/c1-9-2-4-10(5-3-9)15(13,14)12-7-6-11-8-12/h2-8H,1H3 |
| InChIKey | YJYMYJRAQYREBT-UHFFFAOYSA-N |
| SMILES | C1N(S(C2=CC=C(C)C=C2)(=O)=O)C=CN=1 |
| CAS DataBase Reference | 2232-08-8(CAS DataBase Reference) |
| UNSPSC Code | 12352005 |
| NACRES | NA.22 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xi |
| Risk statements (R) | 36/37/38 |
| Safety statements (S) | 26-36-24/25 |
| Water hazard class (WGK) | 3 |
| F | 10-21 |
| Customs code | 29332900 |
| Storage class | 11 - Combustible Solids |
| Hazard class | Aquatic Chronic 3Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
Safety & Regulations
| GHS classification | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 41 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| F | 10-21 |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| Customs code | 29332900 |
| Risk statements (R) | 36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| Safety statements (S) | 26-36-24/25 |
| Storage class | 11 - Combustible Solids |
| Target organs | Respiratory system |
| GHS hazard statements | H315-H319-H335 |
| Hazard class | Aquatic Chronic 3Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| GHS precautionary statements | P261-P305+P351+P338-P280a-P304+P340-P405-P501a |
Applications & Uses
Uses
Alcohols to azides in one step.1
Uses
1-(p-Toluenesulfonyl)imidazole was used in the synthesis of cationic water soluble cyclodextrin, mono-6A-(1-butyl-3-imidazolium)-6A-deoxy-β-cyclodextrin chloride (BIMCD), useful in chiral separation of amino acids and anionic pharmaceuticals by capillary electrophoresis.
General Description
1-(p-Toluenesulfonyl)imidazole converts alcohols to azides in one step.