HuagongsheHuagongshe Chemistry Print Report · For research reference only
N,N'-Dimethylethylenediamine
DMEDA · N,N'-Dimethylethylenediamine · SYM-DIMETHYLETHYLENEDIAMINE · DIMETHYLETHYLENEDIAMINE · DMEN · N,N'-dimethylethane-1,2-diamine · 1,2-Dimethylethylenediamine · methyl[2-(methylamino)ethyl]amine
Identifiers & Physical Properties
| CAS No. | 110-70-3 |
|---|---|
| Molecular formula | C4H12N2 |
| Average molar mass | 88.15 g/mol |
| Monoisotopic mass | 88.10004838 g/mol |
| SMILES | CNCCNC |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| PubChem CID | 8070 |
| EC No. | 203-793-3 |
| DTXSID | DTXSID4058730 |
Chemical & Physical Properties
| XLogP | -0.6 |
|---|---|
| Topological polar surface area | 24.1 |
| Hydrogen bond donors | 2 |
| Hydrogen bond acceptors | 2 |
| Rotatable bonds | 3 |
| Heavy atoms | 6 |
| Formal charge | 0 |
| Complexity | 17.5 |
| Chemical classes | Nitrogen Compounds -> Amines, Aliphatic |
| SpringerMaterials Properties | Optical coefficient |
| Vapor pressure | 20.6 [mmHg] |
| Physical Description | Clear light yellow liquid[Sigma-Aldrich MSDS] |
| Melting point | 1.63°C (estimate) |
| Boiling point | 119 °C(lit.) |
| Density | 0.819 g/mL at 20 °C(lit.) |
| Refractive index | n20/D 1.431(lit.) |
| Flash point | 83 °F |
| Storage conditions | Keep in dark place,Inert atmosphere,2-8°C |
| Solubility | Miscible with chloroform and dichloromethane. |
| Physical state | Liquid |
| pKa (acidity coefficient) | 10.54±0.10(Predicted) |
| Specific gravity | 0.828 |
| Color | Clear colorless to slightly yellow |
| Sensitivity | Air Sensitive |
| BRN | 878142 |
| InChI | 1S/C4H12N2/c1-5-3-4-6-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | KVKFRMCSXWQSNT-UHFFFAOYSA-N |
| SMILES | CNCCNC |
| LogP (partition coefficient) | -0.620 |
| CAS DataBase Reference | 110-70-3(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | JBC5EX42TL |
| NIST Chemistry Reference | CH3NHCH2CH2NHCH3(110-70-3) |
| EPA Substance Registry System | 1,2-Ethanediamine, N,N'-dimethyl- (110-70-3) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS02,GHS05 |
| Signal word | Danger |
| GHS hazard statements | H226-H314 |
| GHS precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Personal protective equipment (PPE) | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard symbols | C |
| Risk statements (R) | 10-34-20/21/22 |
| Safety statements (S) | 26-36/37/39-45-16 |
| UN transport number | UN 2734 8/PG 2 |
| Water hazard class (WGK) | 3 |
| RTECS number | KV4250000 |
| TSCA inventory status | TSCA listed |
| Hazard class | 3Eye Dam. 1Flam. Liq. 3Skin Corr. 1B |
| Packing group | III |
| Customs code | 29212900 |
| Storage class | 3 - Flammable liquids |
| Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 235, 1982. |
| Limited quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
Safety & Regulations
| GHS classification | DangerH226 (98.9%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P260, P261, P264, P264+P265, P271, P280, P301+P330+P331, P302+P352, P302+P361+P354, P303+P361+P353, P304+P340, P305+P351+P338, P305+P354+P338, P316, P317, P319, P321, P332+P317, P337+P317, P362+P364, P363, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 89 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazards summary | Intraperitoneal LD50 (mouse) = 200 mg/kg[RTECS] Causes burnsInhalation may cause corrosive injuries to upper respiratory tract and lungs[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Flam. Liq. 3 (98.9%) |
| Adverse effects | Dermatotoxin - Skin burns. |
| Personal protective equipment (PPE) | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Water hazard class (WGK) | 3 |
| TSCA inventory status | TSCA listed |
| RTECS number | KV4250000 |
| UN transport number | UN 2734 8/PG 2 |
| Customs code | 29212900 |
| Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 17, Pg. 235, 1982. |
| Risk statements (R) | 10-34-20/21/22 |
| Signal word | Danger |
| GHS pictogram | GHS02,GHS05 |
| Hazard symbols | C |
| Safety statements (S) | 26-36/37/39-45-16 |
| Hazard class | 3Eye Dam. 1Flam. Liq. 3Skin Corr. 1B |
| Storage class | 3 - Flammable liquids |
| Packing group | III |
| GHS hazard statements | H226-H314 |
| Limited quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
| GHS precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
Applications & Uses
Uses
Has a DNA binding effect
Uses
N,N'-Dimethylethylenediamine is used in DNA binding effect. It is used to enhance the adsorption of carbon dioxide. It acts as a ligand and form coordination complex such as dinitrato(N,N'-dimethyl-1,2-ethanediamine)copper(II) and dichloro(1,4-bis-(diphenyl phosphino)butane)-(1,2-ethylenediamine)ruthenium(II).