HuagongsheHuagongshe Chemistry Print Report · For research reference only
2-Bromo-5-nitroaniline
AKOS BBS-00001987 · 2-Bromo-5-nitroaniL · 2-BROMO-5-NITROANILINE · 2-Bromo-5-nitroaniline,98% · 2-Bromo-5-nitroaniline >2-Bromo-5-nitroaniline 98% · 3-Amino-4-bromonitrobenzene · Benzenamine, 2-bromo-5-nitro- · 2-Bromo-5-nitroaniline, GC 98%
Identifiers & Physical Properties
| CAS No. | 10403-47-1 |
|---|---|
| Molecular formula | C6H5BrN2O2 |
| Average molar mass | 217.02 g/mol |
| Monoisotopic mass | 215.9534395 g/mol |
| SMILES | Nc1cc([N+](=O)[O-])ccc1Br |
| InChIKey | BAAUCXCLMDAZEL-UHFFFAOYSA-N |
| PubChem CID | 82607 |
| ChEMBL | CHEMBL106285 |
| EC No. | 233-874-9 |
| DTXSID | DTXSID50146225 |
Chemical & Physical Properties
| XLogP | 2.3 |
|---|---|
| Topological polar surface area | 71.8 |
| Hydrogen bond donors | 1 |
| Hydrogen bond acceptors | 3 |
| Rotatable bonds | 0 |
| Heavy atoms | 11 |
| Formal charge | 0 |
| Complexity | 159 |
| Melting point | 139-141 °C (lit.) |
| Boiling point | 334.5±22.0 °C(Predicted) |
| Density | 1.7917 (rough estimate) |
| Refractive index | 1.5150 (estimate) |
| Storage conditions | Keep in dark place,Inert atmosphere,Room temperature |
| pKa (acidity coefficient) | 0.49±0.10(Predicted) |
| Physical state | Fine Crystalline Needles or Crystalline Powder |
| Color | Dark yellow to khaki |
| Solubility | slightly soluble |
| BRN | 2803492 |
| InChI | 1S/C6H5BrN2O2/c7-5-2-1-4(9(10)11)3-6(5)8/h1-3H,8H2 |
| InChIKey | BAAUCXCLMDAZEL-UHFFFAOYSA-N |
| SMILES | Nc1cc(ccc1Br)[N+]([O-])=O |
| CAS DataBase Reference | 10403-47-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Bromo-5-nitroaniline(10403-47-1) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
| GHS pictogram | GHS07 |
| Signal word | Warning |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Target organs | Respiratory system |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard symbols | Xi |
| Risk statements (R) | 36/37/38 |
| Safety statements (S) | 26-36-37/39 |
| UN transport number | UN 2811 6.1/PG 3 |
| Water hazard class (WGK) | 3 |
| Hazard class | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Packing group | III |
| Customs code | 29214200 |
| Storage class | 11 - Combustible Solids |
Safety & Regulations
| GHS classification | WarningH302 (15.2%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (15.2%) |
| Personal protective equipment (PPE) | dust mask type N95 (US), Eyeshields, Gloves |
| Water hazard class (WGK) | 3 |
| UN transport number | UN 2811 6.1/PG 3 |
| Customs code | 29214200 |
| Risk statements (R) | 36/37/38 |
| Signal word | Warning |
| GHS pictogram | GHS07 |
| Hazard symbols | Xi |
| Safety statements (S) | 26-36-37/39 |
| Hazard class | 6.1Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| Storage class | 11 - Combustible Solids |
| Packing group | III |
| Target organs | Respiratory system |
| GHS hazard statements | H315-H319-H335 |
| GHS precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
Applications & Uses
Uses
2-Bromo-5-nitroaniline reacts with phosgene iminium chloride to give a dimethylcarbamimidic chloride intermediate, which is then treated with primary amines to form guanidinyl derivatives and ultimately 5-nitrobenzimidazole derivatives[1]. 2-Bromo-5-nitroaniline can be acetylated and then thionated to give the corresponding thioamide, or heated with an amide and POCl3 in toluene to afford amidine derivatives[2].