Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,2,3,4-Tetrafluorobenzene
1,2,3,4-TetrafL · o-Tetrafluorobenzene · 1,2,3,4-Tetrafluorob · 4-flurobenzoyl chloride · Moxifloxacin Impurity 84 · 1,2,3,4-Tetrafluorbenzol · 1,2,3,4-Tetrafluorobenzyl · 1,2,3,6-Tetrafluorobenzene
식별자 및 물리적 특성
| CAS No. | 28016-01-5 |
|---|---|
| 분자식 | C6H2F4 |
| 평균 분자량 | 150.07 g/mol |
| 단동위원소 질량 | 150.00926294 g/mol |
| SMILES | Fc1ccc(F)c(F)c1F |
| InChIKey | SOZFIIXUNAKEJP-UHFFFAOYSA-N |
| PubChem CID | 11084 |
| EC No. | 208-997-6 |
| DTXSID | DTXSID60870605 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 0 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 102 |
| 물질 분류 | Other Classes -> Halogenated Monoaromatics |
| SpringerMaterials Properties | Coriolis coupling |
| 증기압 | 49.5 [mmHg] |
| Physical Description | Clear colorless liquid[Sigma-Aldrich MSDS] |
| 녹는점 | -42 °C (lit.) |
| 끓는 점 | 95 °C (lit.) |
| 밀도 | 1.4 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.408(lit.) |
| 인화점 | 69 °F |
| 저장 조건 | Sealed in dry,2-8°C |
| 물리적 상태 | 투명한 액체 |
| 색상 | Colorless to Light yellow to Light orange |
| 비중 | 1.400 |
| BRN | 1910024 |
| 안정성 | 안정적인. 가연성이 높습니다. 강한 산화제와 호환되지 않습니다. |
| InChI | InChI=1S/C6H2F4/c7-3-1-2-4(8)6(10)5(3)9/h1-2H |
| InChIKey | SOZFIIXUNAKEJP-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C(F)=C1F |
| NIST | Benzene, 1,2,3,4-tetrafluoro-(551-62-2) |
화학적 성질
colourless liquid
안전 및 규제
| GHS 분류 | DangerH225 (100%): Highly Flammable liquid and vapor [Danger Flammable liquids]P210, P233, P240, P241, P242, P243, P261, P264, P264+P265, P271, P280, P302+P352, P303+P361+P353, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P370+P378, P403+P233, P403+P235, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 5 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 유해성 요약 | A skin and strong eye irritant[Sigma-Aldrich MSDS] See p-Bromofluorobenzene. |
| Hazard Classes and Categories | Flam. Liq. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1993 3/PG 2 |
| 관세 코드 | 29039990 |
| 위험 문구(R) | 11-36/37/38 |
| 위험 표시 | F,Xi |
| 안전 문구(S) | 16-26-36/37/39-33-7/9 |
| 포장분류 | II |
| 위험 등급 | 3Eye Irrit. 2Flam. Liq. 2Skin Irrit. 2STOT SE 3 |
| 위험 참고 사항 | Flammable |
| 저장 분류 | 3 - Flammable liquids |