Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
4-클로로-6-니트로퀴나졸린
4-클로로-6-니트로퀴나졸린 · 4-Chloro-6-nitro-quizoline · 4-choro-6-nitroquinazoline · 4-CHLORO-6-NITROQUINAZOLINE · Quinazoline,4-chloro-6-nitro-
식별자 및 물리적 특성
| CAS No. | 19815-16-8 |
|---|---|
| 분자식 | C8H4ClN3O2 |
| 평균 분자량 | 209.59 g/mol |
| 단동위원소 질량 | 208.99920405 g/mol |
| SMILES | O=[N+]([O-])c1ccc2ncnc(Cl)c2c1 |
| InChIKey | LZOSFEDULGODDH-UHFFFAOYSA-N |
| PubChem CID | 11356257 |
| EC No. | 972-052-0 |
| DTXSID | DTXSID10463364 |
| 현지명 | 4-클로로-6-니트로퀴나졸린 |
화학 및 물리적 성질
| XLogP | 2.3 |
|---|---|
| 극성 표면적 | 71.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 233 |
| 녹는점 | 128 °C |
| 끓는 점 | 380.0±22.0 °C(Predicted) |
| 밀도 | 1.566±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 디클로로메탄 에 용해됨 |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 0.14±0.50(Predicted) |
| 색상 | 갈색 |
화학적 성질
Brown Solid
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 신호 어 | Warning |
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H302 |
용도
용도
Intermediate in the preparation of anticancer agents and enzyme inhibitors.