식별자 및 물리적 특성
| CAS No. | 40182-06-7 |
|---|
| 분자식 | C12H11NO2S |
|---|
| 평균 분자량 | 233.29 g/mol |
|---|
| 단동위원소 질량 | 233.05104977 g/mol |
|---|
| SMILES | NS(=O)(=O)c1ccccc1-c1ccccc1 |
|---|
| InChIKey | SBXDENYROQKXBE-UHFFFAOYSA-N |
|---|
| PubChem CID | 12371520 |
|---|
| ChEMBL | CHEMBL4091235 |
|---|
| EC No. | 841-176-6 |
|---|
| DTXSID | DTXSID50494854 |
|---|
화학 및 물리적 성질
| XLogP | 2.1 |
|---|
| 극성 표면적 | 68.5 |
|---|
| 수소 결합 공여자 수 | 1 |
|---|
| 수소 결합 수용자 수 | 3 |
|---|
| 회전 가능 결합 수 | 2 |
|---|
| 무거운 원자 수 | 16 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 314 |
|---|
| 녹는점 | 121-122 °C(Solv: ethanol (64-17-5)water (7732-18-5)) |
|---|
| 끓는 점 | 443.1±38.0 °C(Predicted) |
|---|
| 밀도 | 1.270±0.06 g/cm3(Predicted) |
|---|
| pKa(산도 계수) | 9.99±0.60(Predicted) |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposureRespiratory tract irritation]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%)Skin Irrit. 2 (100%)Eye Irrit. 2A (100%)STOT SE 3 (100%) |
|---|
| 신호 어 | Warning |
|---|
| 유해·위험 문구 | 암호 유해·위험 문구 위험 등급 범주 신호 어 그림 문자 P- 코드 H317 |
|---|
