Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
N10-(Trifluoroacetyl)pteroic acid
Testosterone Impurity 42 · TRIFLUOROACETYLPTEROIC ACID · 10-trifluoroacetyl-pteroic acid · N1?-(Trifluoroacetyl)pteroic acid · N10-(Trifluoroacetyl)pteroic acid · N10-(Trifluoroacetyl)pteroic acid 95% · N(sup 10)-(trifluoroacetyl)pteroic acid · Butterfly Acid Series/N10 Trifluoroacetyl Butterfly Acid
식별자 및 물리적 특성
| CAS No. | 37793-53-6 |
|---|---|
| 분자식 | C16H11F3N6O4 |
| 평균 분자량 | 408.29 g/mol |
| 단동위원소 질량 | 408.07938749 g/mol |
| SMILES | Nc1nc2ncc(CN(C(=O)C(F)(F)F)c3ccc(C(=O)O)cc3)nc2c(=O)[nH]1 |
| InChIKey | IJGIHDXKYQLIMA-UHFFFAOYSA-N |
| PubChem CID | 135405262 |
| ChEMBL | CHEMBL46163 |
| EC No. | 624-434-0 |
| DTXSID | DTXSID50403885 |
화학 및 물리적 성질
| XLogP | 0.2 |
|---|---|
| 극성 표면적 | 151 |
| 수소 결합 공여자 수 | 3 |
| 수소 결합 수용자 수 | 10 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 29 |
| 형식 전하 | 0 |
| 복잡도 | 707 |
| 녹는점 | 270 °C (dec.)(lit.) |
| 끓는 점 | 575.0±60.0 °C(Predicted) |
| 밀도 | 1.74±0.1 g/cm3(Predicted) |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | DMF(약간 용해됨), DMSO(약간 용해됨) |
| pKa(산도 계수) | 4.11±0.10(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 갈색에서 진한 갈색까지 |
| 안정성 | 흡습성 |
| InChI | InChI=1S/C16H11F3N6O4/c17-16(18,19)14(29)25(9-3-1-7(2-4-9)13(27)28)6-8-5-21-11-10(22-8)12(26)24-15(20)23-11/h1-5H,6H2,(H,27,28)(H3,20,21,23,24,26) |
| InChIKey | IJGIHDXKYQLIMA-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(N(CC2=CN=C3C(=N2)C(=O)NC(N)=N3)C(C(F)(F)F)=O)C=C1 |
화학적 성질
white Solid
안전 및 규제
| GHS 분류 | DangerH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P317, P318, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2811 6.1/PG 3 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 45-20/21/22-36/37/38 |
| 위험 표시 | T |
| 안전 문구(S) | 53-22-26-36/37/39-45 |
| 위험 등급 | Acute Tox. 4 OralCarc. 1BEye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 6.1C - Combustible acute toxic Cat.3toxic compounds or compounds which causing chronic effects |
용도
용도
N10-Trifluoroacetylpteroic acid is a derivative of Pteroic acid (P840110), both of which are used as reagents to synthesize target ligands, like Folic acid (F680300), that have the ability to deliver chemotherapeutic agents specifically to cancer cells.