Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,3,2-Dioxathiolane, 2,2-dioxide
DTD · 1,3,2-DIOXATHIOLANE 2,2-DIOXIDE · 1,2-ETHYLENE SULFATE · Vinyl sulfate · ETHYLENESULPHATE · Ethylenedithiocarbonate · 1,3,2-Dioxathiolan-2,2-oxide · 1,3,2-Dioxathiolan-2,2-dioxide
식별자 및 물리적 특성
| CAS No. | 1072-53-3 |
|---|---|
| 분자식 | C2H4O4S |
| 평균 분자량 | 124.12 g/mol |
| 단동위원소 질량 | 123.98302961 g/mol |
| SMILES | O=S1(=O)OCCO1 |
| InChIKey | ZPFAVCIQZKRBGF-UHFFFAOYSA-N |
| PubChem CID | 14075 |
| ChEMBL | CHEMBL3186939 |
| EC No. | 600-809-4 |
| DTXSID | DTXSID3020598 |
화학 및 물리적 성질
| XLogP | -0.5 |
|---|---|
| 극성 표면적 | 61 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 7 |
| 형식 전하 | 0 |
| 복잡도 | 128 |
| SpringerMaterials Properties | Chemical shift |
| 녹는점 | 95-97 °C (lit.) |
| 끓는 점 | 231.1±7.0℃ (760 Torr) |
| 밀도 | 1.604±0.06 g/cm3 (20 ºC 760 Torr) |
| 증기압 | 0.91-1.7Pa at 20-25℃ |
| 굴절률 | 1.5090 (estimate) |
| 인화점 | 93.5±18.2℃ |
| 저장 조건 | 2-8°C |
| 용해도 | 클로로포름, 메탄올에 용해됨 |
| 물리적 상태 | 고체 |
| 색상 | 흰색에서 황백색까지 |
| InChI | InChI=1S/C2H4O4S/c3-7(4)5-1-2-6-7/h1-2H2 |
| InChIKey | ZPFAVCIQZKRBGF-UHFFFAOYSA-N |
| SMILES | C1OS(=O)(=O)OC1 |
| LogP(분배 계수) | -0.45 at 23℃ and pH1.4-1.7 |
| 표면장력 | 66.8mN/m at 1g/L and 20℃ |
화학적 성질
White Solid
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 2.5% (2 of 80) of reports.DangerH302 (92.5%): Harmful if swallowed [Warning Acute toxicity, oral]P203, P260, P261, P264, P264+P265, P270, P272, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P317, P318, P321, P330, P333+P317, P362+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 80 reports by companies from 11 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| 규제 정보 | Status: Active Update: 06-12-2022 https://echa.europa.eu/registration-dossier/-/registered-dossier/23959 |
| Hazard Classes and Categories | Acute Tox. 4 (92.5%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | JH4800000 |
| 관세 코드 | 29209085 |
| 위험 문구(R) | 22 |
| 기존화학 물질 | 2014-3-6101 |
| 위험 등급 | Acute Tox. 4 OralCarc. 2Eye Dam. 1Skin Corr. 1BSkin Sens. 1B |
| 저장 분류 | 8B - Non-combustible corrosive hazardous materials |
용도
용도
1,3,2-Dioxathiolane 2,2-Dioxide is an alkylating agent with carcinogenic activty.