Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
DL-플루오로시트르산바륨염
DL-플루오로시트르산바륨염 · dl-fluorocitric acid · barium DL-fluorocitrate · DL-FLUOROCITRIC ACID, BARIUM · DL-FLUOROCITRIC ACID BARIUM SALT · barium,1-fluoro-2-hydroxypropane-1,2,3-tricarboxylicaci · Pentaric acid,3-C-carboxy-2,4-dideoxy-2-fluoro-, barium salt (2:3) · Pentaric acid,3-C-carboxy-2,4-dideoxy-2-fluoro-, barium salt (2:3) (9CI)
식별자 및 물리적 특성
| CAS No. | 100929-81-5 |
|---|---|
| 분자식 | C6H7BaFO7 |
| 평균 분자량 | 347.44 g/mol |
| 단동위원소 질량 | 347.92282798 g/mol |
| SMILES | O=C(O)CC(O)(C(=O)O)C(F)C(=O)O.[Ba] |
| InChIKey | JZXYXUPAJRFPBS-UHFFFAOYSA-N |
| PubChem CID | 16219377 |
| EC No. | 634-489-2 |
| DTXSID | DTXSID30585158 |
| 현지명 | DL-플루오로시트르산바륨염 |
화학 및 물리적 성질
| 극성 표면적 | 132 |
|---|---|
| 수소 결합 공여자 수 | 4 |
| 수소 결합 수용자 수 | 8 |
| 회전 가능 결합 수 | 5 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 275 |
안전 및 규제
| GHS 분류 | DangerH300 (100%): Fatal if swallowed [Danger Acute toxicity, oral]P260, P262, P264, P270, P271, P280, P284, P301+P316, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P320, P321, P330, P361+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 2 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2811 6.1/PG 1 |
| 위험 문구(R) | 26/27/28-34 |
| 위험 표시 | T+ |
| 안전 문구(S) | 36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 6.1(a) |
용도
용도
DL-Fluorocitric acid barium salt has been used as an astrocyte inhibitor in various experiments.