아이리쉬모스
아이리쉬모스 · IOTA-CARRAGEENAN · TS 150 · MOSS IRISH · IRISH MOSS · Aids031651 · SeaSpen PF · Isish Moss
식별자 및 물리적 특성
| CAS No. | 9062-07-1 |
|---|---|
| 분자식 | C24H34O31S4-4 |
| 평균 분자량 | 946.8 g/mol |
| SMILES | O=S(=O)([O-])O[C@@H]1[C@H]2OC[C@@H](O[C@@H]1O)[C@@H]2O[C@@H]1O[C@H](CO)[C@H](OS(=O)(=O)[O-])[C@H](O[C@H]2O[C@@H]3CO[C@@H]([C@H]3O[C@@H]3O[C@H](CO)[C@H](OS(=O)(=O)[O-])[C@H](O)[C@H]3O)[C@H]2OS(=O)(=O)[O-])[C@H]1O |
| InChIKey | QIDSWKFAPCTSKL-RRQHLKGPSA-J |
| ChEBI | CHEBI:37168 |
| 현지명 | 아이리쉬모스 |
화학 및 물리적 성질
| XLogP | -9.4 |
|---|---|
| 극성 표면적 | 504 |
| 수소 결합 공여자 수 | 6 |
| 수소 결합 수용자 수 | 31 |
| 회전 가능 결합 수 | 12 |
| 무거운 원자 수 | 59 |
| 형식 전하 | -4 |
| 복잡도 | 1,840 |
| 저장 조건 | room temp |
| 용해도 | H2O: 5 mg/mL 뜨거운, 용해성 |
| 물리적 상태 | 가루 |
| 색상 | 흰색에서 옅은 갈색까지 |
| pH | 8.0 - 10.5 |
| 생물학적 소스 | algae (Eucheuma spinosum) |
| 용해도 | 물에 부분적으로 용해되고 뜨거운 물에 용해됩니다. 뜨거운 농축 염 용액에서는 에탄올에 불용성입니다. |
| Merck | 14,1858 |
| 화장품 원료 기능 | 피부 컨디셔닝 |
| InChIKey | QIDSWKFAPCTSKL-RRQHLKGPSA-J |
화학적 성질
sulfate content >35%, forms no gels powder
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| 관세 코드 | 13023990 |
| 안전 문구(S) | 24/25 |
| F 고인화성물질 | 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
Carrageenans are used to suppress immune response in vivo and in vitro via mechanisms believed to involve selective cytopathic effect on macrophages. As ι-, κ-,and λ-carrageenans have varying degress of sulfation, they may be studied comparatively for differences in protective, antiviral, and immunosuppression activities.
일반 설명
Carrageenans are mucopolysaccharides from the cell walls of the red algae. They are anionic linear polymers composed of 1,3α-1,4β-galactans having one (κ-), two (ι-) or three (λ-) sulfates per disaccharide unit. In ionic solutions, κ- and ι-carrageenans self-associate into helical structures that form rigid or flexible gels, respectively. λ-carrageenans do not form helices and are non-gelling. Carrageenans are used commercially as thickeners and stabilizing agents.