Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Hepta-1,6-dien-4-ol
hepta-1,6-dien-4-ol · 4-hepta-1,6-dienol · 1,6-HEPTADIEN-4-OL · 1,6-HEPTADIENE-4-OL · 1,6-Heptadien-4-ol,97% · 1,6-HEPTADIEN-4-OL 97% · 1,6-Heptadien-4-ol, 97% 5GR · 1,6-HEPTADIEN-4-OL ISO 9001：2015 REACH
식별자 및 물리적 특성
| CAS No. | 2883-45-6 |
|---|---|
| 분자식 | C7H12O |
| 평균 분자량 | 112.17 g/mol |
| 단동위원소 질량 | 112.088815 g/mol |
| SMILES | C=CCC(O)CC=C |
| InChIKey | UTGFOWQYZKTZTN-UHFFFAOYSA-N |
| PubChem CID | 17902 |
| ChEBI | CHEBI:229301 |
| EC No. | 220-742-0 |
| DTXSID | DTXSID70870999 |
화학 및 물리적 성질
| XLogP | 1.8 |
|---|---|
| 극성 표면적 | 20.2 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 4 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 66.5 |
| Polymers | Other Classes -> Alcohols and Polyols, Other |
| Physical Description | Liquid[Sigma-Aldrich MSDS] |
| 끓는 점 | 151 °C (lit.) |
| 밀도 | 0.864 g/mL at 25 °C (lit.) |
| 굴절률 | n20/D 1.45(lit.) |
| 인화점 | 104 °F |
| 저장 조건 | Inert atmosphere,2-8°C |
| 물리적 상태 | 액체 |
| 색상 | 무색투명~연황색 |
| InChI | InChI=1S/C7H12O/c1-3-5-7(8)6-4-2/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | UTGFOWQYZKTZTN-UHFFFAOYSA-N |
| SMILES | C=CCC(O)CC=C |
| LogP(분배 계수) | 1.911 (est) |
화학적 성질
Clear colorless to light yellow liquid
안전 및 규제
| GHS 분류 | WarningH226 (100%): Flammable liquid and vapor [Warning Flammable liquids]P210, P233, P240, P241, P242, P243, P280, P303+P361+P353, P370+P378, P403+P235, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 42 reports by companies from 4 notifications to the ECHA C&L Inventory. |
|---|---|
| 유해성 요약 | Intravenous LD50 (mouse) = 180 mg/kg[RTECS] May cause irritation[Sigma-Aldrich MSDS] |
| Hazard Classes and Categories | Flam. Liq. 3 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | MI5450000 |
| 운송 번호(UN) | UN 1987 3/PG 3 |
| 관세 코드 | 29052990 |
| 위험 문구(R) | 10 |
| 안전 문구(S) | 16 |
| 포장분류 | III |
| 위험 등급 | 3.2Flam. Liq. 3 |
| 기존화학 물질 | KE-18258 |
| 저장 분류 | 3 - Flammable liquids |
용도
용도
1,6-Heptadien-4-ol (monoterpene alcohol) was used as the internal standard in the quantitation and identification of the important aroma components in wine. It was used to study the co- and terpolymerization reactions of carbon monoxide and propene with dicationic biphosphine palladium(II) as the catalyst.
일반 설명
1,6-Heptadien-4-ol can help in synthesizing the derivatives of guanine, adenine, uracil and thymine via Mitsunobu condensation.