Aniracetam
AMpaMet · sarpul · anixiku · draganon · Anisitan · Ro 13-3057 · RO 13-5057 · ANIRACETAM
식별자 및 물리적 특성
| CAS No. | 72432-10-1 |
|---|---|
| 분자식 | C12H13NO3 |
| 평균 분자량 | 219.24 g/mol |
| 단동위원소 질량 | 219.08954328 g/mol |
| SMILES | COc1ccc(C(=O)N2CCCC2=O)cc1 |
| InChIKey | ZXNRTKGTQJPIJK-UHFFFAOYSA-N |
| PubChem CID | 2196 |
| ChEMBL | CHEMBL36994 |
| ChEBI | CHEBI:47943 |
| EC No. | 615-758-3 |
| DTXSID | DTXSID5045128 |
화학 및 물리적 성질
| XLogP | 1.6 |
|---|---|
| 극성 표면적 | 46.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 16 |
| 형식 전하 | 0 |
| 복잡도 | 282 |
| 의약품 | Pharmaceuticals -> Synthetic Cannabinoids or Psychoactive CompoundsPharmaceuticals -> Listed in ZINC15 |
| LogP(분배 계수) | 0.93 |
| Endocrine Disruptors | Potential endocrine disrupting compound |
| Collision Cross Section | 145.49 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards]146.6 Ų [M+H]+ [CCS Type: TW |
| 녹는점 | 121-122C |
| 끓는 점 | 399.7±34.0 °C(Predicted) |
| 밀도 | 1.236±0.06 g/cm3(Predicted) |
| 저장 조건 | Sealed in dry,Room Temperature |
| 용해도 | 클로로포름(약간 용해됨), 메탄올(약간 용해됨) |
| pKa(산도 계수) | -1.74±0.20(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 하얀색 |
| 용해도 | 클로로포름에 용해됩니다. 에탄올에도 용해됩니다. 물에 불용성 |
| Merck | 14,662 |
| InChI | InChI=1S/C12H13NO3/c1-16-10-6-4-9(5-7-10)12(15)13-8-2-3-11(13)14/h4-7H,2-3,8H2,1H3 |
| InChIKey | ZXNRTKGTQJPIJK-UHFFFAOYSA-N |
| SMILES | N1(C(=O)C2=CC=C(OC)C=C2)CCCC1=O |
화학적 성질
Aniracetam is a white or colorless solid. It has a molecular structure that consists of an organic compound with a methoxy group attached to one side of a benzene ring, and a carboxylic acid group attached to the other side. It forms crystals when dissolved in ethanol, and has a melting point of 121-122°C. Exhibits acute toxicity in rats and mice, with LD50 values of approximately 4500mg/kg and >5000mg/kg when administered orally.
안전 및 규제
| GHS 분류 | This chemical does not meet GHS hazard criteria for 33.3% (1 of 3) of reports.WarningH361 (66.7%): Suspected of damaging fertility or the unborn child [Warning Reproductive toxicity]P203, P280, P318, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 3 reports by companies from 2 notifications to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Repr. 2 (66.7%) |
| 수질 위해 등급(WGK) | 2 |
| RTECS 번호 | UY5781900 |
| 독성 | LD50 in rats, mice (mg/kg): ~4500, >5000 orally (Cumin) |
| 관세 코드 | 2933.79.1500 |
용도
개요
Aniracetam, also known as N-anisoyl-2-pyrrolidinone, together with piracetam and nefiracetam, belong to the same class of piracetam metabolized drugs of brain cells. It is a non-NMDA receptor agent useful for the treatment of cognitive impairment. These drugs can enhance the activity of synaptic neurons phospholipase, increase the ATP formation and transport in brain, increase protein synthesis and RNA, promote the usage of brain on amino acids, phospholipids, glucose and oxygen, increase the patient's response, excitability and memory. Aniracetam has a higher effect than piracetam, but with a relatively minor side effect. It is well tolerated and efficacious in improving velocity and accuracy of the saccades, complex reaction time, and other aspects of performance.
용도
Aniracetam is AMPA receptor potentiator with Cognition enhancer related to Piracetam. It is used as a nootropic drug to ameliorate memory and attention disturbances accompanying cerebrovascular diseases and degenerative brain disorders. Compound with anti-depressive properties used as a mental performance enhancer. Slows the rate of ion-channel closing.
제조 및 합성 방법
제조 방법
Aniracetam is prepared by condensing 2-pyrrolidone with 4-methoxybenzoyl chloride. The drug was first made in the 1970s by Hoffmann-La Roche. This piracetam-related cognition enhancer reduces glutamate receptor desensitization.