Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Methyl (3-(trifluoromethyl)phenyl)acetate
Methyl 2-(3-( · AURORA KA-6005 · Methyl 2-(3-(trifluoromethyl) · Methyle3-(trifluoromethyl)phenylacetate · Methyl 3-(trifluoromethyl)phenylacetate · Methyl3-(trifluoromethyl)phenylacetate,95% · Methyl 2-[3-(trifluoromethyl)phenyl]acetate · Methyl 3-(trifluoromethyl)phenylacetate,97%
식별자 및 물리적 특성
| CAS No. | 62451-84-7 |
|---|---|
| 분자식 | C10H9F3O2 |
| 평균 분자량 | 218.17 g/mol |
| 단동위원소 질량 | 218.05546419 g/mol |
| SMILES | COC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChIKey | GMEBDKGPPKAPEM-UHFFFAOYSA-N |
| PubChem CID | 2734603 |
| EC No. | 642-719-8 |
| DTXSID | DTXSID90370385 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 26.3 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 5 |
| 회전 가능 결합 수 | 3 |
| 무거운 원자 수 | 15 |
| 형식 전하 | 0 |
| 복잡도 | 225 |
| 끓는 점 | 211℃ |
| 밀도 | 1.24 |
| 굴절률 | 1.45-1.452 |
| 저장 조건 | Sealed in dry,Room Temperature |
| 물리적 상태 | 액체 |
| 색상 | 무색의 |
| InChI | 1S/C10H9F3O2/c1-15-9(14)6-7-3-2-4-8(5-7)10(11,12)13/h2-5H,6H2,1H3 |
| InChIKey | GMEBDKGPPKAPEM-UHFFFAOYSA-N |
| SMILES | O=C(OC)CC1=CC(C(F)(F)F)=CC=C1 |
화학적 성질
clear colorless liquid
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | WGK 3 |
| 관세 코드 | 29163900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 37/39-26 |
| 위험 등급 | IRRITANTAcute Tox. 4 Oral |
| 저장 분류 | 11 - Combustible Solids |