Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2-(METHYLSULFONYL)벤젠설폰일클로라이드
2-(METHYLSULFONYL)벤젠설폰일클로라이드 · o-Chlorosulfonylphenyl methyl sulfone. · 2-Methysulfonylbenzenesulfonyl chloride · 2-METHYLSULPHONYLBENZENESULFONYL CHLORIDE · 2-(Chlorosulphonyl)phenyl methyl sulphone · 2-METHYLSULPHONYLBENZENESULPHONYL CHLORIDE · 2-(Methylsulfonyl)benzenesulfonyl chloride · Benzenesulfonyl chloride, 2-(methylsulfonyl)-
식별자 및 물리적 특성
| CAS No. | 89265-35-0 |
|---|---|
| 분자식 | C7H7ClO4S2 |
| 평균 분자량 | 254.7 g/mol |
| 단동위원소 질량 | 253.94742838 g/mol |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)Cl |
| InChIKey | XPJTUCSESGEMOI-UHFFFAOYSA-N |
| PubChem CID | 2735178 |
| EC No. | 638-950-9 |
| DTXSID | DTXSID00370614 |
| 현지명 | 2-(METHYLSULFONYL)벤젠설폰일클로라이드 |
화학 및 물리적 성질
| XLogP | 1.2 |
|---|---|
| 극성 표면적 | 85 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 14 |
| 형식 전하 | 0 |
| 복잡도 | 386 |
| 녹는점 | 133-138 °C |
| 끓는 점 | 442.0±37.0 °C(Predicted) |
| 밀도 | 1.4936 (estimate) |
| 물리적 상태 | 결정성 분말 |
| 색상 | 황백색에서 황갈색까지 |
| 용해도 | 물과 반응합니다. |
화학적 성질
off-white to yellowish-brown crystalline powder
안전 및 규제
| GHS 분류 | DangerH302 (12.5%): Harmful if swallowed [Warning Acute toxicity, oral]P260, P261, P264, P264+P265, P270, P271, P280, P301+P317, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P351+P338, P305+P354+P338, P316, P319, P321, P330, P332+P317, P337+P317, P362+P364, P363, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 8 reports by companies from 4 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (12.5%) |
| 운송 번호(UN) | UN3261 |
| 관세 코드 | 29049095 |
| 위험 문구(R) | 36/37/38-34 |
| 위험 표시 | Xi,C |
| 안전 문구(S) | 37/39-26-45-36/37/39 |
| 포장분류 | II |
| 위험 등급 | 8 |
| 위험 참고 사항 | Corrosive |