Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
2,2-Difluoro-2-(fluorosulfonyl)acetic acid
2,2-DIFLUORO-2-(FLUOROSULFONYL)ACETIC ACID · 2,2-DIFLUORO-2-(FLUOROSULFONYL)ACETATE · (Fluorosulfonyl)difluoroacetic acid · Difluoro(fluorosulphonyl)acetic acid · 2-(FLUOROSULFONYL)DIFLUOROACETIC ACID · 2-(FLUOROSULPHONYL)DIFLUOROACETIC ACID · Difluoro(fluorosulphonyl)acetic acid 98% · 2,2-Difluoro-2-(fluorosulfony)acetic Acid
식별자 및 물리적 특성
| CAS No. | 1717-59-5 |
|---|---|
| 분자식 | C2HF3O4S |
| 평균 분자량 | 178.09 g/mol |
| 단동위원소 질량 | 177.95476417 g/mol |
| SMILES | O=C(O)C(F)(F)S(=O)(=O)F |
| InChIKey | VYDQUABHDFWIIX-UHFFFAOYSA-N |
| PubChem CID | 2737516 |
| EC No. | 629-236-8 |
| DTXSID | DTXSID10372104 |
화학 및 물리적 성질
| XLogP | 0.5 |
|---|---|
| 극성 표면적 | 79.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 7 |
| 회전 가능 결합 수 | 2 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 236 |
| 끓는 점 | 153 °C(lit.) |
| 밀도 | 1.723 g/mL at 25 °C(lit.) |
| 굴절률 | n20/D 1.36(lit.) |
| 인화점 | >230 °F |
| 저장 조건 | Storage temp. 2-8°C |
| 용해도 | 클로로포름(에 용해됨), DMSO(약간 용해됨) |
| 물리적 상태 | 액체 |
| pKa(산도 계수) | -0.38±0.10(Predicted) |
| 색상 | 무색의 |
| 용해도 | 물에 용해됩니다. |
| InChI | InChI=1S/C2HF3O4S/c3-2(4,1(6)7)10(5,8)9/h(H,6,7) |
| InChIKey | VYDQUABHDFWIIX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)S(F)(=O)=O |
안전 및 규제
| GHS 분류 | DangerH300 (86.3%): Fatal if swallowed [Danger Acute toxicity, oral]P260, P262, P264, P270, P280, P301+P316, P301+P330+P331, P302+P352, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P330, P361+P364, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 51 reports by companies from 9 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 1 (86.3%) |
| 수질 위해 등급(WGK) | 3 |
| TSCA 등재 상태 | No |
| 운송 번호(UN) | UN 1760 8/PG 2 |
| 관세 코드 | 29159000 |
| 위험 문구(R) | 34-35-27/28 |
| 위험 표시 | C,T+ |
| 안전 문구(S) | 26-27-36/37/39-45-28 |
| 포장분류 | II |
| 위험 등급 | 8Acute Tox. 2 OralSkin Corr. 1A |
| 위험 참고 사항 | Corrosive |
| 저장 분류 | 6.1A - Combustible acute toxic Cat. 1 and 2very toxic hazardous materials |
용도
용도
An important reagent in the synthesis of difluorocarbenes and difluorocyclopropanes.
일반 설명
2,2-Difluoro-2-(fluorosulfonyl)acetic acid reagent is employed as a difluorocarbene source for difluoromethylation of phenolic hydroxyl groups.