Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
7-플루오로인돌
7-플루오로인돌 · 7-FLUORO-1H-INDOLE · uoro-1H-indoL · 7-Flouroindole · 7-ETHOXYINDOLE · 7-FLUOROINDOLE · 7-Fluoroindole>BUTTPARK 24\07-35 · 7-Fluoroindole,97%
식별자 및 물리적 특성
| CAS No. | 387-44-0 |
|---|---|
| 분자식 | C8H6FN |
| 평균 분자량 | 135.14 g/mol |
| 단동위원소 질량 | 135.04842741 g/mol |
| SMILES | Fc1cccc2cc[nH]c12 |
| InChIKey | XONKJZDHGCMRRF-UHFFFAOYSA-N |
| PubChem CID | 2774504 |
| ChEMBL | CHEMBL6147011 |
| EC No. | 640-248-2 |
| DTXSID | DTXSID60379062 |
| 현지명 | 7-플루오로인돌 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 15.8 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 1 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 10 |
| 형식 전하 | 0 |
| 복잡도 | 126 |
| 녹는점 | 61 °C |
| 끓는 점 | 258.0±13.0 °C(Predicted) |
| 밀도 | 1.273±0.06 g/cm3(Predicted) |
| 인화점 | >110° |
| 저장 조건 | 2-8°C |
| 용해도 | 메탄올에 용해됩니다. (거의 투명함) |
| pKa(산도 계수) | 15.55±0.30(Predicted) |
| 물리적 상태 | powder to crystal |
| 색상 | White to Light yellow to Light orange |
| BRN | 114740 |
| InChI | InChI=1S/C8H6FN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5,10H |
| InChIKey | XONKJZDHGCMRRF-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2F)C=C1 |
화학적 성질
Brown solid
안전 및 규제
| GHS 분류 | DangerH302 (61.9%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P305+P354+P338, P317, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 63 reports by companies from 7 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Acute Tox. 4 (61.9%) |
| 수질 위해 등급(WGK) | 3 |
| 관세 코드 | 29339900 |
| 위험 문구(R) | 36/37/38-41-37/38-22 |
| 위험 표시 | Xi,Xn |
| 안전 문구(S) | 26-36-39 |
| 위험 참고 사항 | Irritant |
| 위험 등급 | Acute Tox. 4 OralEye Dam. 1Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
7-Fluoroindole is a reagent used in chemical synthesis. It has been used to synthesize antiviral compounds against Pseudomonas aeruginosa and Staphylococcus aureus along with creation of immunomodulators. It is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs.