식별자 및 물리적 특성
| CAS No. | 16423-68-0 |
|---|
| 분자식 | C20H6I4Na2O5 |
|---|
| 평균 분자량 | 879.9 g/mol |
|---|
| SMILES | O=C([O-])c1ccccc1-c1c2cc(I)c(=O)c(I)c-2oc2c(I)c([O-])c(I)cc12.[Na+].[Na+] |
|---|
| InChIKey | IINNWAYUJNWZRM-UHFFFAOYSA-L |
|---|
| PubChem CID | 27872 |
|---|
| ChEMBL | CHEMBL2028187 |
|---|
| ChEBI | CHEBI:61000 |
|---|
| EC No. | 629-600-6 |
|---|
| DTXSID | DTXSID901015598 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 89.5 |
|---|
| 수소 결합 공여자 수 | 0 |
|---|
| 수소 결합 수용자 수 | 5 |
|---|
| 회전 가능 결합 수 | 1 |
|---|
| 무거운 원자 수 | 31 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 796 |
|---|
| 화장품 | Hair dyeing |
|---|
| Animal Drugs | Pharmaceuticals -> UK Veterinary Medicines Directorate List |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P264, P270, P301+P317, P330, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 39 reports by companies from 1 notifications to the ECHA C&L Inventory. |
|---|
| 규제 정보 | Erythrosine sodium: Does not have an individual approval but may be used as a component in a product covered by a group standard. It is not approved for use as a chemical in its own right. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Carcinogen Classification | No indication of carcinogenicity to humans (not listed by IARC). |
|---|
