Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
10-Undecynoic acid
undec-10-ynoic acid · 10-undecynoate · 10-cyanic acid · Hendecynoic acid · undec-10-ynoicaci · 10-Undecynoic acid · TIMTEC-BB SBB008483 · 10-Undecynoic acid 95%
식별자 및 물리적 특성
| CAS No. | 2777-65-3 |
|---|---|
| 분자식 | C11H18O2 |
| 평균 분자량 | 182.26 g/mol |
| 단동위원소 질량 | 182.13067982 g/mol |
| SMILES | C#CCCCCCCCCC(=O)O |
| InChIKey | OAOUTNMJEFWJPO-UHFFFAOYSA-N |
| PubChem CID | 31039 |
| ChEBI | CHEBI:185054 |
| EC No. | 220-471-8 |
| DTXSID | DTXSID2075219 |
화학 및 물리적 성질
| XLogP | 3.3 |
|---|---|
| 극성 표면적 | 37.3 |
| 수소 결합 공여자 수 | 1 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 8 |
| 무거운 원자 수 | 13 |
| 형식 전하 | 0 |
| 복잡도 | 176 |
| 지질 | Fatty Acyls [FA] -> Fatty Acids and Conjugates [FA01] -> Unsaturated fatty acids [FA0103] |
| 녹는점 | 40-42 °C (lit.) |
| 끓는 점 | 180 °C/15 mmHg (lit.) |
| 밀도 | 0.9898 (rough estimate) |
| 굴절률 | 1.4066 (estimate) |
| 인화점 | >230 °F |
| 저장 조건 | Refrigerator |
| 용해도 | 클로로포름(약간 용해됨), 에틸아세테이트(약간 용해됨) |
| 물리적 상태 | 고체 |
| pKa(산도 계수) | 4.78±0.10(Predicted) |
| 색상 | 회백색 |
| 용해도 | 물에 거의 용해되지 않습니다. |
| BRN | 1704918 |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| InChIKey | OAOUTNMJEFWJPO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCCCC#C |
| EPA | 10-Undecynoic acid (2777-65-3) |
안전 및 규제
| GHS 분류 | WarningH315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 46 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|---|
| Hazard Classes and Categories | Skin Irrit. 2 (100%) |
| 수질 위해 등급(WGK) | 3 |
| RTECS 번호 | YQ3683000 |
| 독성 | mouse,LD50,intravenous,32mg/kg (32mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#07969, |
| 관세 코드 | 29161900 |
| 위험 문구(R) | 36/37/38 |
| 위험 표시 | Xi |
| 안전 문구(S) | 26-36 |
| 기존화학 물질 | KE-35119 |
| F 고인화성물질 | 10-23 |
| 위험 등급 | Eye Irrit. 2Skin Irrit. 2STOT SE 3 |
| 저장 분류 | 11 - Combustible Solids |
용도
용도
10-Undecynoic Acid is a fatty acid used in the synthesis of copolyesters.
일반 설명
10-Undecynoic acid (10- UDYA, UDY) is an acetylenic fatty acid. It is reported as highly selective irreversible inhibitor of hepatic ω- and ω-1-lauric acid hydroxylases. Enzyme catalyzed esterification of 10-undecynoic acid has been reported. UDY has been reported to be synthesized by the dehydrobromination of 10-undecenoic acid.