Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
1,2-Diaminocyclohexane, cis-
(1R,2S)-cyclohexane-1,2-diaMine · cis< · Compound Fr14224 · (2-aminocyclohexyl)amine · cis-1,2-Cyclohexandiamine · CIS-1,2-CYCLOHEXANEDIAMINE · CIS-1,2-DIAMINOCYCLOHEXANE · meso-1,2-Cyclohexanediamine
식별자 및 물리적 특성
| CAS No. | 1436-59-5 |
|---|---|
| 분자식 | C6H14N2 |
| 평균 분자량 | 114.19 g/mol |
| 단동위원소 질량 | 114.11569845 g/mol |
| SMILES | N[C@@H]1CCCC[C@@H]1N |
| InChIKey | SSJXIUAHEKJCMH-OLQVQODUSA-N |
| PubChem CID | 342917 |
| EC No. | 604-372-0 |
| DTXSID | DTXSID501311027 |
화학 및 물리적 성질
| XLogP | -0.3 |
|---|---|
| 극성 표면적 | 52 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 2 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 8 |
| 형식 전하 | 0 |
| 복잡도 | 62.9 |
| 녹는점 | 8°C |
| 끓는 점 | 92-93 °C/18 mmHg (lit.) |
| 밀도 | 0.952 g/mL at 25 °C (lit.) |
| 증기압 | 0.4 mm Hg ( 20 °C) |
| 굴절률 | n20/D 1.493(lit.) |
| 인화점 | 161 °F |
| 저장 조건 | Keep in dark place,Inert atmosphere,Room temperature |
| 용해도 | Completely miscible in water |
| 물리적 상태 | 저융점 고체 |
| pKa(산도 계수) | 9.93(at 20℃) |
| 색상 | 갈색 |
| InChI | InChI=1/C6H14N2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4,7-8H2/t5-,6+ |
| InChIKey | SSJXIUAHEKJCMH-OLQVQODUSA-N |
| SMILES | [C@@H]1(N)CCCC[C@@H]1N |&1:0,6,r| |
| NIST | cis-1,2-Cyclohexanediamine(1436-59-5) |
화학적 성질
Clear colorless liquid
안전 및 규제
| GHS 분류 | DangerH314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation]P260, P264, P280, P301+P330+P331, P302+P361+P354, P304+P340, P305+P354+P338, P316, P321, P363, P405, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 44 reports by companies from 5 notifications to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Status: Active Update: 12-12-2017 https://echa.europa.eu/registration-dossier/-/registered-dossier/21661 |
| Hazard Classes and Categories | Skin Corr. 1B (100%) |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 2735 8/PG 2 |
| 관세 코드 | 29213000 |
| 위험 문구(R) | 34 |
| 위험 표시 | C |
| 안전 문구(S) | 26-36/37/39-45 |
| 포장분류 | II |
| 위험 등급 | 8Eye Dam. 1Skin Corr. 1B |
| F 고인화성물질 | 10-34 |
| 저장 분류 | 8A - Combustible corrosive hazardous materials |
용도
용도
cis-1,2-Diaminocyclohexane was used in the synthesis of platinum complexes that have high antitumor activity.It was also used in the synthesis of multidentate ligands for uranyl and transition metal complexation.
일반 설명
cis-1,2-Diaminocyclohexane perturbed the spectrum of free pyrroloquinoline quinone (PQQ), a covalently linked form of which is the carbonyl cofactor of lysyl oxidase and also induced similar changes in the spectrum of lysyl oxidase.