식별자 및 물리적 특성
| CAS No. | 34183-22-7 |
|---|
| 분자식 | C21H28ClNO3 |
|---|
| 평균 분자량 | 377.9 g/mol |
|---|
| 단동위원소 질량 | 377.17577144 g/mol |
|---|
| SMILES | CCCNCC(O)COc1ccccc1C(=O)CCc1ccccc1.Cl |
|---|
| InChIKey | XWIHRGFIPXWGEF-UHFFFAOYSA-N |
|---|
| PubChem CID | 36708 |
|---|
| ChEMBL | CHEMBL1201063 |
|---|
| ChEBI | CHEBI:8466 |
|---|
| EC No. | 251-867-9 |
|---|
| DTXSID | DTXSID101017233 |
|---|
화학 및 물리적 성질
| 극성 표면적 | 58.6 |
|---|
| 수소 결합 공여자 수 | 3 |
|---|
| 수소 결합 수용자 수 | 4 |
|---|
| 회전 가능 결합 수 | 11 |
|---|
| 무거운 원자 수 | 26 |
|---|
| 형식 전하 | 0 |
|---|
| 복잡도 | 368 |
|---|
| 용해도 | >56.7 [ug/mL] (The mean of the results at pH 7.4) |
|---|
| Human Drugs | FDA approved drugs -> Active ingredient |
|---|
| Collision Cross Section | 177.2 Ų [M+H]+ [CCS Type: TWMethod: calibrated with polyalanine and drug standards] |
|---|
안전 및 규제
| GHS 분류 | WarningH302 (100%): Harmful if swallowed [Warning Acute toxicity, oral]P261, P264, P270, P271, P280, P301+P317, P302+P352, P304+P340, P317, P321, P330, P362+P364, and P501 (click each P-code to see the statement)Aggregated GHS information provided per 154 reports by companies from 6 notifications to the ECHA C&L Inventory. Each notification may be associated with multiple companies. |
|---|
| Hazard Classes and Categories | Acute Tox. 4 (100%) |
|---|
| Drug Induced Liver Injury | Drug Induced Liver Injury Rank (DILIrank 2.0)Propafenone hydrochloridevLess-DILI-concern3Adverse reactionsDOI:10.1016/j.drudis.2016.02.015 |
|---|
