Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
플루오레스카민
플루오레스카민 · 플루오레스카민(FLUORESCAMINE) · FLURAM · Fluaram · FLURAM(R) · RO 20-7234 · Fluorescamin · FLUORESCAMINE
식별자 및 물리적 특성
| CAS No. | 38183-12-9 |
|---|---|
| 분자식 | C17H10O4 |
| 평균 분자량 | 278.26 g/mol |
| 단동위원소 질량 | 278.0579088 g/mol |
| SMILES | O=C1OC2(OC=C(c3ccccc3)C2=O)c2ccccc21 |
| InChIKey | ZFKJVJIDPQDDFY-UHFFFAOYSA-N |
| PubChem CID | 37927 |
| EC No. | 253-814-5 |
| DTXSID | DTXSID50872017 |
| 현지명 | 플루오레스카민 |
화학 및 물리적 성질
| XLogP | 2.9 |
|---|---|
| 극성 표면적 | 52.6 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 1 |
| 무거운 원자 수 | 21 |
| 형식 전하 | 0 |
| 복잡도 | 503 |
| 물질 분류 | Dyes -> Indicator Dyes |
| Physical Description | Off-white odorless powder[Alfa Aesar MSDS] |
| 녹는점 | 153-157 °C (lit.) |
| 끓는 점 | 381.08°C (rough estimate) |
| 밀도 | 1.2661 (rough estimate) |
| 굴절률 | 1.5447 (estimate) |
| 인화점 | -17 °C |
| 저장 조건 | room temp |
| 용해도 | 아세토니트릴: 가용성 |
| 물리적 상태 | 가루 |
| 색상 | 황백색에서 노란색까지 |
| 용해도 | 에 용해됨아세톤, 에탄올, 에 용해됨클로로포름, 디메틸설폭사이드 및 아세토니트릴에 용해됩니다. 물에 약간 용해됩니다. |
| Merck | 14,4158 |
| BRN | 921143 |
| 안정성 | 안정적인. 강한 산화제와 호환되지 않습니다. |
| InChI | 1S/C17H10O4/c18-15-13(11-6-2-1-3-7-11)10-20-17(15)14-9-5-4-8-12(14)16(19)21-17/h1-10H |
| InChIKey | ZFKJVJIDPQDDFY-UHFFFAOYSA-N |
| SMILES | O=C1OC2(OC=C(C2=O)c3ccccc3)c4ccccc14 |
| NIST | Spiro[furan-2(3h),1'(3'h)-isobenzofuran]-3,3'-dione, 4-phenyl-(38183-12-9) |
화학적 성질
white powder
안전 및 규제
| GHS 분류 | WarningH319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]P261, P264+P265, P271, P280, P304+P340, P305+P351+P338, P319, P337+P317, P403+P233, P405, and P501 (click each P-code to see the statement)The GHS information provided by 1 company from 1 notification to the ECHA C&L Inventory. |
|---|---|
| 규제 정보 | Spiro[furan-2(3H),1'(3'H)-isobenzofuran]-3,3'-dione, 4-phenyl-: Does not have an individual approval but may be used under an appropriate group standard |
| 유해성 요약 | May cause irritation[Alfa Aesar MSDS] |
| 수질 위해 등급(WGK) | 3 |
| 운송 번호(UN) | UN 1090 3/PG 2 |
| 관세 코드 | 29322090 |
| 위험 문구(R) | 11-36/38-66-67-36-36/37/38 |
| 위험 표시 | F,Xi |
| 안전 문구(S) | 22-24/25-36/37-33-29-26-16-9-37/39 |
| 기존화학 물질 | KE-28441 |
| F 고인화성물질 | 10-21 |
| 저장 분류 | 13 - Non Combustible Solids |
용도
용도
Fluorescamine is a non-fluorescent reagent that reacts readily under mild conditions with primary amines in amino acids and peptides to form stable, highly fluorescent compounds. Reaction takes place under mild conditions. Low background due to hydrolysis.