Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
디히드로-4,4-디메틸-2,3-푸란디온
디히드로-4,4-디메틸-2,3-푸란디온 · DIHYDRO-4 · 4-DIMETHYL-2 · 3-FURANDIONE · Ketopantolactone · keto-pantoyllactone · 2-dehydropantolactone · alpha-Ketopantolactone
식별자 및 물리적 특성
| CAS No. | 13031-04-4 |
|---|---|
| 분자식 | C6H8O3 |
| 평균 분자량 | 128.13 g/mol |
| 단동위원소 질량 | 128.04734411 g/mol |
| SMILES | CC1(C)COC(=O)C1=O |
| InChIKey | HRTOQFBQOFIFEE-UHFFFAOYSA-N |
| PubChem CID | 39 |
| ChEBI | CHEBI:18395 |
| EC No. | 235-891-7 |
| DTXSID | DTXSID30156448 |
| 현지명 | 디히드로-4,4-디메틸-2,3-푸란디온 |
화학 및 물리적 성질
| XLogP | 0.6 |
|---|---|
| 극성 표면적 | 43.4 |
| 수소 결합 공여자 수 | 0 |
| 수소 결합 수용자 수 | 3 |
| 회전 가능 결합 수 | 0 |
| 무거운 원자 수 | 9 |
| 형식 전하 | 0 |
| 복잡도 | 169 |
| 녹는점 | 67-69 °C (lit.) |
| 끓는 점 | 125-126℃ (15 Torr) |
| 밀도 | 1.152±0.06 g/cm3(Predicted) |
| 저장 조건 | under inert gas (nitrogen or Argon) at 2-8°C |
| 용해도 | 디클로로메탄: 용해성25mg/mL, 투명, 무색~노란색 |
| 물리적 상태 | 고체 |
| 색상 | 페일베이지 |
| InChI | InChI=1S/C6H8O3/c1-6(2)3-9-5(8)4(6)7/h3H2,1-2H3 |
| InChIKey | HRTOQFBQOFIFEE-UHFFFAOYSA-N |
| SMILES | O1CC(C)(C)C(=O)C1=O |
안전 및 규제
| 수질 위해 등급(WGK) | 3 |
|---|---|
| 저장 분류 | 11 - Combustible Solids |
용도
일반 설명
Dihydro-4,4-dimethyl-2,3-furandione is an activated keto compound and its enantioselective hydrogenation was reported. Neutral Rhodium (I) aminophosphine-phosphinite complex calatyzed asymmetric hydrogenation of dihydro-4,4-dimethyl-2,3-furandione was reported. Asymmetric hydrogenation of dihydro-4,4-dimethyl-2,3-furandione gives D-(-)-pantoyl lactone, a key intermediate in the synthesis of pantothenic acid.