Huagongshe화공사 화학 정보 인쇄 보고서 · 연구 참고용
Lorglumide
cr1409 · LORGLUMIDE · IEKOTSCYBBDIJC-UHFFFAOYSA-N · LORGLUMIDE SODIUM SALT (CR 1409) NON-PEP TIDE CCK ANTAG · d,l-4-(3,4-dichlorobenzoylamino)-5-(dipentylamino)-5-oxo-pentanoicacid · 4-dichlorobenzoyl)amino)-5-(dipentylamino)-5-oxo-4-(((+-)-pentanoicaci · Pentanoic acid, 4-[(3,4-dichlorobenzoyl)amino]-5-(dipentylamino)-5-oxo- · (±)-4-[(3,4-dichlorobenzoyl)amino]-5-(dipentylamino)-5-oxopentanoic acid sodium salt
식별자 및 물리적 특성
| CAS No. | 97964-56-2 |
|---|---|
| 분자식 | C22H32Cl2N2O4 |
| 평균 분자량 | 459.4 g/mol |
| 단동위원소 질량 | 458.17391286 g/mol |
| SMILES | CCCCCN(CCCCC)C(=O)C(CCC(=O)O)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChIKey | IEKOTSCYBBDIJC-UHFFFAOYSA-N |
| PubChem CID | 3960 |
| ChEMBL | CHEMBL24938 |
| ChEBI | CHEBI:88307 |
| DTXSID | DTXSID2046961 |
화학 및 물리적 성질
| XLogP | 5.5 |
|---|---|
| 극성 표면적 | 86.7 |
| 수소 결합 공여자 수 | 2 |
| 수소 결합 수용자 수 | 4 |
| 회전 가능 결합 수 | 14 |
| 무거운 원자 수 | 30 |
| 형식 전하 | 0 |
| 복잡도 | 537 |
| 끓는 점 | 621.4±55.0 °C(Predicted) |
| 밀도 | 1.195±0.06 g/cm3(Predicted) |
| 용해도 | 45%(w/v) 수성 2-히드록시프로필-β-시클로덱스트린: >10mg/mL |
| pKa(산도 계수) | 4.47±0.10(Predicted) |
| 물리적 상태 | 고체 |
| 색상 | 하얀색 |
안전 및 규제
| 수질 위해 등급(WGK) | 2 |
|---|---|
| RTECS 번호 | SA3680700 |
용도
용도
Lorglumide is a specific cholecytokinin receptor antagonist. It is also an intermediate in synthesizing Lorglumide Sodium Salt (L469910), a nonpeptidic antagonist of the CCK A receptor, and minimally effective at the CCK B receptor. It blocks CCK -mediated muscle contraction, pancreatic growth and secretion.